202982-63-6 Usage
Description
4-Chloro-2-fluorobenzylamine hydrochloride is an organic compound characterized by its light yellow powder form. It is a derivative of benzylamine, featuring a chlorine atom at the 4th position and a fluorine atom at the 2nd position on the benzene ring. 4-CHLORO-2-FLUOROBENZYLAMINE HYDROCHLORIDE is known for its reactivity and is commonly utilized in the synthesis of various pharmaceuticals and chemicals.
Uses
Used in Pharmaceutical Industry:
4-Chloro-2-fluorobenzylamine hydrochloride is used as a primary and secondary intermediate in the synthesis of various pharmaceutical compounds. Its unique structure allows for further functionalization and modification, making it a versatile building block in the development of new drugs.
Used in Chemical Synthesis:
In the chemical industry, 4-chloro-2-fluorobenzylamine hydrochloride serves as an intermediate for the production of various chemicals. Its reactivity and structural features enable the creation of a wide range of compounds with diverse applications, including agrochemicals, dyes, and other specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 202982-63-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,2,9,8 and 2 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 202982-63:
(8*2)+(7*0)+(6*2)+(5*9)+(4*8)+(3*2)+(2*6)+(1*3)=126
126 % 10 = 6
So 202982-63-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H7ClFN/c8-6-2-1-5(4-10)7(9)3-6/h1-3H,4,10H2
202982-63-6Relevant articles and documents
AMIDE COMPOUND AND METHOD OF CONTROLLING PLANT DISEASE WITH THE SAME
-
Page/Page column 108, (2010/02/14)
A amid compound of the formula (1): wherein, in the formula, R51 represents a halogen atom, a C1-C6 alkyl group and the like; R52 represents a hydrogen atom, a halogen atom, a C1-C6 alkyl group and the like; R53 represents a halogen atom and the like; R56 represents a halogen atom and the like; R57 represents a hydrogen atom and the like; R58 and R59 independently represent a hydrogen atom, a C1-C3 alkyl group and the like; R60 represents a C1-C4 alkyl group, a C1-C4 haloalkyl group, a C3-C4 alkenyl group, or a C3-C6 alkynyl group; R61 represents a C1-C4 alkyl group, a C1-C4 haloalkyl group, a C3-C4 alkenyl group or a C3-C6 alkynyl group or a C2-C4 cyanoalkyl group; R62, R63 and R64 represent a hydrogen atom, a halogen atom and the like; X represents a oxygen atom or a sulfur atom; has an excellent activity against plant diseases.