2265-92-1 Usage
Description
2,5-Difluoroiodobenzene, also known as 1,4-Difluoro-2-iodobenzene, is a chemical compound characterized by its yellow liquid appearance. It is a derivative of benzene with two fluorine atoms and one iodine atom substituting its hydrogen atoms at the 2nd and 5th positions, respectively.
Uses
Used in Chemical Synthesis:
2,5-Difluoroiodobenzene is used as a key intermediate in the synthesis of various organic compounds, such as 3,6-difluoro-1,2-phenylenediboronic acid and 3,6-difluoro-2-iodobenzoic acid. Its unique structure and reactivity make it a valuable building block for creating complex molecules with potential applications in various industries.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2,5-Difluoroiodobenzene is used as a starting material for the development of novel drugs with specific therapeutic properties. Its unique chemical structure allows for the creation of new molecules with potential applications in treating various diseases and medical conditions.
Used in Material Science:
2,5-Difluoroiodobenzene can also be utilized in the field of material science for the development of new materials with specific properties. Its incorporation into polymers or other materials can lead to enhanced characteristics, such as improved thermal stability, chemical resistance, or electrical conductivity.
Used in Research and Development:
Due to its unique chemical properties, 2,5-Difluoroiodobenzene is also used in research and development laboratories for studying various chemical reactions and exploring new synthetic pathways. It serves as a valuable tool for chemists and researchers working on the development of new compounds and materials with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 2265-92-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,2,6 and 5 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 2265-92:
(6*2)+(5*2)+(4*6)+(3*5)+(2*9)+(1*2)=81
81 % 10 = 1
So 2265-92-1 is a valid CAS Registry Number.
InChI:InChI=1/C6H3F2I/c7-4-1-2-5(8)6(9)3-4/h1-3H
2265-92-1Relevant articles and documents
Iodination of Deactivated Aromatics with N-Iodosuccinimide in Trifluoromethanesulfonic Acid (NIS-CF3SO3H) via in Situ Generated Superelectrophile Iodine(I) Trifluoromethanesulfonate
Olah, George A.,Wang, Qi,Sandford, Graham,Prakash, G. K. Surya
, p. 3194 - 3195 (1993)
-
Method for producing tetrakis ( fluoroaryl) borate-magnesium compound
-
, (2008/06/13)
Fluoroaryl magnesium halide is reacted with a boron compound so that a molar ratio of the fluoroaryl magnesium halide to the boron compound is not less than 3.0 and not more than 3.7, so as to produce a tetrakis (fluoroaryl) borate·magnesium compound. With this method, there occurs no hydrogen fluoride which corrodes a producing apparatus and requires troublesome waste water treatment.
