24474-93-9 Usage
Description
2-Methyl-5(4H)-oxazolone is an organic compound belonging to the oxazolone family, characterized by a five-membered oxazole ring with a methyl group at the second position and a ketone group at the fifth position. It is known for its unique chemical properties and potential applications in various fields.
Uses
Used in Chemical Research:
2-Methyl-5(4H)-oxazolone is used as a chemical intermediate for the synthesis of various complex organic molecules and pharmaceutical compounds. Its unique structure allows for versatile chemical reactions and modifications, making it a valuable building block in organic chemistry.
Used in Multireference Configuration Interaction Studies:
In the field of computational chemistry, 2-methyl-5(4H)-oxazolone is employed as a subject for multireference configuration interaction studies with singles and doubles of some mesoionic rings. These studies aim to determine reaction and activation free energies for the ring-opening reaction, providing valuable insights into the reaction mechanisms and potential applications of this compound.
Used in Pharmaceutical Development:
Due to its unique chemical properties, 2-methyl-5(4H)-oxazolone has potential applications in the development of new pharmaceuticals. Its ability to form various derivatives and interact with different biological targets makes it a promising candidate for the design of novel drugs with specific therapeutic effects.
Used in Material Science:
The unique structure and properties of 2-methyl-5(4H)-oxazolone also make it a candidate for the development of new materials with specific properties, such as improved stability, reactivity, or selectivity. Its potential applications in material science could lead to the creation of advanced materials for various industries, including electronics, energy, and environmental protection.
Synthesis Reference(s)
Synthesis, p. 418, 1984 DOI: 10.1055/s-1984-30859
Check Digit Verification of cas no
The CAS Registry Mumber 24474-93-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,4,4,7 and 4 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 24474-93:
(7*2)+(6*4)+(5*4)+(4*7)+(3*4)+(2*9)+(1*3)=119
119 % 10 = 9
So 24474-93-9 is a valid CAS Registry Number.
InChI:InChI=1/C4H5NO2/c1-3-5-2-4(6)7-3/h2H2,1H3
24474-93-9Relevant articles and documents
Trans-Diastereoselective Ru(II)-Catalyzed Asymmetric Transfer Hydrogenation of α-Acetamido Benzocyclic Ketones via Dynamic Kinetic Resolution
Cotman, Andrej Emanuel,Lozin?ek, Matic,Wang, Baifan,Stephan, Michel,Mohar, Barbara
, p. 3644 - 3648 (2019)
A highly efficient enantio- and diastereoselective catalyzed asymmetric transfer hydrogenation via dynamic kinetic resolution (DKR-ATH) of α,β-dehydro-α-acetamido and α-acetamido benzocyclic ketones to ent-trans-β-amido alcohols is disclosed employing a new ansa-Ru(II) complex of an enantiomerically pure syn-N,N-ligand, i.e. ent-syn-ULTAM-(CH2)3Ph. DFT calculations of the transition state structures revealed an atypical two-pronged substrate attractive stabilization engaging the commonly encountered CH/πelectrostatic interaction and a new additional O=S=O···HNAc H-bond hence favoring the trans-configured products.
A novel one flask synthesis of 1,2-substituted 5-imidazolones
Dasgupta, Purbasha,Taunk, Archana
experimental part, p. 1242 - 1245 (2010/08/19)
One flask synthesis of 4-arylmethylene-1-phenyl-2-styryl-2-imidazolin-5- ones was achieved by the phenyl isothiocyanate-mediated condensation of N-acetyl glycine with aromatic aldehydes.
ORGANIC COMPOUNDS
-
Page/Page column 33, (2010/11/27)
The invention related to a novel process, novel process steps and novel intermediates useful in the synthesis of pharmaceutically active compounds, especially renin inhibitors, such as Aliskiren. Inter alia, the invention relates to a process for the manu
