26681-88-9 Usage
Description
Divinylphenylphosphine is an organic compound that features a phosphine group attached to a divinylbenzene structure. It is known for its unique chemical properties and reactivity, making it a versatile compound in various applications.
Uses
Used in Chemical Synthesis:
Divinylphenylphosphine is used as a reactant for the synthesis of P-chiral phosphines. Its application is particularly valuable in the chiral metal template promoted asymmetric furan Diels-Alder reaction, which is a crucial process in the development of enantiomerically pure compounds with potential applications in pharmaceuticals, agrochemicals, and other industries.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, Divinylphenylphosphine is used as a key intermediate in the synthesis of various biologically active molecules. Its unique reactivity allows for the creation of novel compounds with potential therapeutic applications.
Used in Agrochemical Industry:
Divinylphenylphosphine is also utilized in the agrochemical industry for the development of new pesticides and other crop protection agents. Its role in the synthesis of chiral compounds can lead to the creation of more effective and selective products with reduced environmental impact.
Used in Material Science:
In the field of material science, Divinylphenylphosphine can be employed as a component in the development of advanced materials with specific properties, such as improved conductivity or enhanced stability. Its versatility in chemical reactions allows for the creation of tailored materials for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 26681-88-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,6,8 and 1 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 26681-88:
(7*2)+(6*6)+(5*6)+(4*8)+(3*1)+(2*8)+(1*8)=139
139 % 10 = 9
So 26681-88-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H11P/c1-3-11(4-2)10-8-6-5-7-9-10/h3-9H,1-2H2
26681-88-9Relevant articles and documents
New superhindered polydentate polyphosphine ligands P(CH2CH 2PtBu2)3, PhP(CH2CH 2PtBu2)2, P(CH2CH 2CH2PtBu2)3, and their ruthenium(II) chloride complexes
Gilbert-Wilson, Ryan,Field, Leslie D.,Bhadbhade, Mohan M.
experimental part, p. 3239 - 3246 (2012/04/10)
The synthesis and characterization of the extremely hindered phosphine ligands, P(CH2CH2PtBu2)3 (P2P3tBu, 1), PhP(CH2CH 2PtBu2)2 (PhP2P 2tBu, 2), and P(CH2CH2CH 2PtBu2)3 (P3P 3tBu, 3) are reported, along with the synthesis and characterization of ruthenium chloro complexes RuCl2(P 2P3tBu) (4), RuCl2(PhP 2P2tBu) (5), and RuCl2(P 3P3tBu) (6). The bulky P2P 3tBu (1) and P3P3tBu (3) ligands are the most sterically encumbered PP3-type ligands so far synthesized, and in all cases, only three phosphorus donors are able to bind to the metal center. Complexes RuCl2(PhP2P2 tBu) (5) and RuCl2(P3P3 tBu) (6) were characterized by crystallography. Low temperature solution and solid state 31P{1H} NMR were used to demonstrate that the structure of RuCl2(P2P 3tBu) (4) is probably analogous to that of RuCl 2(PhP2P2tBu) (5) which had been structurally characterized.
