29958-19-8 Usage
Description
5-ACETAMIDO-2-BROMOPYRIDINE is an organic compound with the molecular formula C6H6BrN2O. It is a derivative of pyridine, a heterocyclic compound with a six-membered ring and one nitrogen atom. The presence of an acetamido group at the 5th position and a bromine atom at the 2nd position gives this compound unique chemical properties and reactivity.
Uses
Used in Chemical Organic Syntheses:
5-ACETAMIDO-2-BROMOPYRIDINE is used as a reagent in chemical organic syntheses, particularly for the couplings of 2-halopyridines. Its unique structure allows it to participate in various chemical reactions, making it a valuable component in the synthesis of complex organic molecules.
Used in Pharmaceutical Industry:
5-ACETAMIDO-2-BROMOPYRIDINE is used as a key intermediate in the preparation of tachykinin receptor antagonists. Tachykinin receptor antagonists are a class of drugs that block the action of tachykinins, which are neuropeptides involved in various physiological processes, including pain transmission, inflammation, and immune response. By blocking these receptors, tachykinin receptor antagonists can potentially be used to treat conditions such as migraine, inflammatory disorders, and certain types of pain.
Check Digit Verification of cas no
The CAS Registry Mumber 29958-19-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,9,9,5 and 8 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 29958-19:
(7*2)+(6*9)+(5*9)+(4*5)+(3*8)+(2*1)+(1*9)=168
168 % 10 = 8
So 29958-19-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H7BrN2O/c1-5(11)10-6-2-3-7(8)9-4-6/h2-4H,1H3,(H,10,11)
