3015-66-5 Usage
Description
DI-N-BUTYL TETRACHLOROPHTHALATE, also known as Dibutyl 2,3,4,5-Tetrachlorophthalate, is a chlorinated derivative of Dibutyl Phthalate (D429495). It is a phthalate metabolite that possesses genotoxic effects, which means it has the potential to damage the genetic information within cells.
Uses
Used in Chemical Industry:
DI-N-BUTYL TETRACHLOROPHTHALATE is used as an additive for its genotoxic properties, which can be utilized in various chemical processes and applications. The specific reasons for its use in the chemical industry may vary depending on the particular process or product being developed.
Used in Research and Development:
In the field of research and development, DI-N-BUTYL TETRACHLOROPHTHALATE is used as a compound for studying its genotoxic effects and potential applications in various scientific and medical fields. This can include understanding its interactions with biopolymers and macromolecules, as well as exploring its potential use in drug development or other therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 3015-66-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,0,1 and 5 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 3015-66:
(6*3)+(5*0)+(4*1)+(3*5)+(2*6)+(1*6)=55
55 % 10 = 5
So 3015-66-5 is a valid CAS Registry Number.
InChI:InChI=1/C16H18Cl4O4/c1-3-5-7-23-15(21)9-10(16(22)24-8-6-4-2)12(18)14(20)13(19)11(9)17/h3-8H2,1-2H3
