31638-96-7 Usage
Description
3,4,5-Trimethoxy-N-3-pyridylbenzamide is an organic compound characterized by its unique chemical structure, which features a benzene ring with three methoxy groups at positions 3, 4, and 5, and a pyridyl group attached to an amide functional group. 3,4,5-trimethoxy-N-3-pyridylbenzamide is known for its potential applications in various fields due to its distinct chemical properties.
Uses
Used in Pharmaceutical Industry:
3,4,5-Trimethoxy-N-3-pyridylbenzamide is used as an intermediate compound for the preparation of iridium benzoylaminopyridinium complex. This complex is of significant interest in the pharmaceutical industry due to its potential applications in the development of new drugs, particularly those targeting cancer cells. The unique structure of 3,4,5-trimethoxy-N-3-pyridylbenzamide allows for the formation of stable complexes with iridium, which can be further explored for their therapeutic properties.
Check Digit Verification of cas no
The CAS Registry Mumber 31638-96-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,1,6,3 and 8 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 31638-96:
(7*3)+(6*1)+(5*6)+(4*3)+(3*8)+(2*9)+(1*6)=117
117 % 10 = 7
So 31638-96-7 is a valid CAS Registry Number.
InChI:InChI=1/C15H16N2O4/c1-19-12-7-10(8-13(20-2)14(12)21-3)15(18)17-11-5-4-6-16-9-11/h4-9H,1-3H3,(H,17,18)
31638-96-7Relevant articles and documents
A mesoionic nitrogen-donor ligand: Structure, iridium coordination, and catalytic effects
Navarro, Miquel,Li, Mo,Bernhard, Stefan,Albrecht, Martin
, p. 659 - 662 (2017)
A mesoinic pyridylideneamide ligand (PYA) was synthetized and fully characterized and coordinated to an iridium(iii) center. This ligand represents the first example of a mesoionic N-donor ligand. Structural and spectroscopic analysis revealed unique properties which were exploited in chemically driven water oxidation catalysis.
