321-12-0 Usage
Description
2-Fluoro-5-methylbenzoic acid is a fluorobenzoic acid derivative, serving as an aryl fluorinated building block. It is characterized by its formation as a major product during the deprotonation of metallated fluorotoluenes when reacted with superbases. This white powder exhibits unique chemical properties that make it valuable in various applications across different industries.
Uses
Used in Pharmaceutical Industry:
2-Fluoro-5-methylbenzoic acid is used as an intermediate compound for the synthesis of various pharmaceuticals. Its unique structure, including the presence of a fluorine atom and a methyl group on the benzene ring, allows for the development of new drugs with potentially improved pharmacological properties, such as enhanced bioavailability, selectivity, and metabolic stability.
Used in Agrochemical Industry:
In the agrochemical sector, 2-Fluoro-5-methylbenzoic acid is utilized as a key building block for the creation of novel agrochemicals. Its incorporation into the molecular structure of these compounds can lead to the development of more effective and targeted pesticides, herbicides, and other agricultural products, ultimately contributing to increased crop yields and reduced environmental impact.
Used in Material Science:
2-Fluoro-5-methylbenzoic acid is employed as a monomer in the synthesis of specialty polymers and materials. The fluorine atom in its structure can impart unique properties to the resulting polymers, such as increased thermal stability, chemical resistance, and non-stick characteristics. These materials can find applications in various industries, including automotive, aerospace, and electronics.
Used in Chemical Research:
As a fluorinated building block, 2-Fluoro-5-methylbenzoic acid is used in academic and industrial research settings to explore new reaction pathways, develop innovative synthetic methods, and create novel compounds with potential applications in various fields, such as medicine, agriculture, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 321-12-0 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 3,2 and 1 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 321-12:
(5*3)+(4*2)+(3*1)+(2*1)+(1*2)=30
30 % 10 = 0
So 321-12-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H7FO2/c1-5-2-3-7(9)6(4-5)8(10)11/h2-4H,1H3,(H,10,11)
321-12-0Relevant articles and documents
Unsymmetrical cyclic ureas as HIV-1 protease inhibitors: Novel biaryl indazoles as P2/P2' substituents
Patel, Mona,Rodgers, James D.,McHugh Jr., Robert J.,Johnson, Barry L.,Cordova, Beverly C.,Klabe, Ronald M.,Bacheler, Lee T.,Erickson-Viitanen, Susan,Soo S, Ko
, p. 3217 - 3220 (2007/10/03)
The preparation of unsymmetrical cyclic ureas bearing novel biaryl indazoles as P2/P2' substituents was undertaken, utilizing a Suzuki coupling reaction as the key step. Compound 6i was equipotent to the lead compound of the series SE063.
Synthesis and mutagenicity of modified chrysenes related to the carcinogen, 5-methylchrysene.
Hecht,Loy,Mazzarese,Hoffmann
, p. 38 - 44 (2007/10/06)
-
