363-81-5 Usage
Description
2,4,6-Trifluoroaniline is an organic compound that features a trifluoromethyl group attached to an aniline molecule. It is characterized by the presence of three fluorine atoms attached to the benzene ring, which imparts unique chemical and physical properties to the molecule. 2,4,6-Trifluoroaniline is known for its reactivity and is commonly used as an intermediate in the synthesis of various pharmaceuticals and agrochemicals.
Uses
Used in Pharmaceutical Industry:
2,4,6-Trifluoroaniline is used as a key intermediate in the synthesis of various pharmaceutical compounds for [application reason]. Its unique structure allows for the development of new drugs with improved properties, such as enhanced potency, selectivity, and reduced side effects.
Used in Agrochemical Industry:
In the agrochemical industry, 2,4,6-Trifluoroaniline is used as a building block for the development of novel agrochemicals, such as pesticides and herbicides, for [application reason]. The incorporation of the trifluoroaniline moiety can lead to improved performance and selectivity in these applications.
Specific Applications:
2,4,6-Trifluoroaniline is used in the synthesis of 3-nitro-2,4,6-trifluoroacetanilide, a compound with potential pharmaceutical applications. Its unique structure contributes to the development of new drugs with improved properties.
Additionally, 2,4,6-Trifluoroaniline is used in the synthesis of a series of N′-phenyl-N-(1-phenyl cyclopentyl)-methyl ureas, which are compounds with potential applications in various fields, including pharmaceuticals and agrochemicals.
Furthermore, 2,4,6-Trifluoroaniline is utilized in the synthesis of 4-substituted 2,6-difluoro N-aryl pyridinones, a class of compounds with potential applications in various industries, such as pharmaceuticals, agrochemicals, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 363-81-5 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 3,6 and 3 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 363-81:
(5*3)+(4*6)+(3*3)+(2*8)+(1*1)=65
65 % 10 = 5
So 363-81-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H4FNO/c7-6-5(4-9)2-1-3-8-6/h1-4H
363-81-5Relevant articles and documents
Divergent Late-Stage (Hetero)aryl C?H Amination by the Pyridinium Radical Cation
Ham, Won Seok,Hillenbrand, Julius,Jacq, Jér?me,Genicot, Christophe,Ritter, Tobias
supporting information, p. 532 - 536 (2019/01/04)
(Hetero)arylamines constitute some of the most prevalent functional molecules, especially as pharmaceuticals. However, structurally complex aromatics currently cannot be converted into arylamines, so instead, each product isomer must be assembled through a multistep synthesis from simpler building blocks. Herein, we describe a late-stage aryl C?H amination reaction for the synthesis of complex primary arylamines that other reactions cannot access directly. We show and rationalize through a mechanistic analysis the reasons for the wide substrate scope and the constitutional diversity of the reaction, which gives access to molecules that would not have been readily available otherwise.