36714-84-8 Usage
Description
DIMETHYL-(2-METHYL-5-NITRO-PHENYL)-AMINE, also known as N,N,2-Trimethyl-5-nitroaniline, is an organic compound that serves as a crucial intermediate in the synthesis of various chemical compounds. It is characterized by its amine functional group and nitro-substituted aromatic ring, which contribute to its reactivity and potential applications in chemical synthesis.
Uses
Used in Pharmaceutical Industry:
DIMETHYL-(2-METHYL-5-NITRO-PHENYL)-AMINE is used as an intermediate in the synthesis of Roseoflavin (R685000), a compound known to compete with Riboflavin in Lactobacillus casei. Its role in the synthesis process is essential for the development of new analogs and potential therapeutic agents.
Used in Biochemical Research:
As a Riboflavin kinase substrate and inhibitor, DIMETHYL-(2-METHYL-5-NITRO-PHENYL)-AMINE plays a significant role in biochemical research. It helps researchers understand the mechanisms of Riboflavin kinase and its interactions with other molecules, which can lead to the discovery of new inhibitors and potential therapeutic targets.
Check Digit Verification of cas no
The CAS Registry Mumber 36714-84-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,6,7,1 and 4 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 36714-84:
(7*3)+(6*6)+(5*7)+(4*1)+(3*4)+(2*8)+(1*4)=128
128 % 10 = 8
So 36714-84-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H12N2O2/c1-7-4-5-8(11(12)13)6-9(7)10(2)3/h4-6H,1-3H3
36714-84-8Relevant articles and documents
2,4 DI (HETERO) -ARYLAMINO-PYRIMIDINE DERIVATIVES AS ZAP-70 AND/OR SYK INHIBITORS
-
Page/Page column 33, (2010/02/11)
Disclosed are pyrimidine derivatives of formula (I); wherein R0, R1, R3 to R9, and Z have a signification as indicated in claim 1, which have ZAP-70 and/or Syk inhibitory activities.
