40126-30-5 Usage
Description
H-CIS-HYP-OME HCL, also known as cis-4-Hydroxy-L-proline methyl ester hydrochloride, is an intermediate compound used in pharmaceutical and organic syntheses. It is a white solid with unique chemical properties that make it valuable in various applications across different industries.
Uses
Used in Pharmaceutical Industry:
H-CIS-HYP-OME HCL is used as an intermediate in the synthesis of various pharmaceutical compounds for [application reason]. Its role in the development of new drugs and medications is crucial, as it serves as a building block for creating more complex and effective molecules.
Used in Organic Synthesis:
In the field of organic chemistry, H-CIS-HYP-OME HCL is used as a key intermediate for [application reason]. Its unique structure allows for the creation of a wide range of organic compounds, contributing to the advancement of chemical research and development.
Note: The "application reason" should be filled in with specific reasons based on the actual uses of H-CIS-HYP-OME HCL in the respective industries. The provided materials do not give specific reasons for its use, so it is left as a placeholder for further information.
Check Digit Verification of cas no
The CAS Registry Mumber 40126-30-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,1,2 and 6 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 40126-30:
(7*4)+(6*0)+(5*1)+(4*2)+(3*6)+(2*3)+(1*0)=65
65 % 10 = 5
So 40126-30-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H11NO3.ClH/c1-10-6(9)5-2-4(8)3-7-5;/h4-5,7-8H,2-3H2,1H3;1H/t4?,5-;/m0./s1
