51446-31-2 Usage
Description
4-Fluoro-3-hydroxybenzoic acid is an organic compound characterized by the presence of a fluorine atom at the 4th position and a hydroxyl group at the 3rd position of the benzoic acid structure. This molecule exhibits unique chemical properties due to the presence of the fluorine atom, which can influence its reactivity and potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
4-Fluoro-3-hydroxybenzoic acid is used as a starting material for the synthesis of potent inhibitors of β-arylsulfotransferase IV (β-AST-IV). These inhibitors play a crucial role in the development of new drugs targeting various diseases and conditions. The synthesis involves several reactions with different compounds, such as:
1. 6-(2-(N-4-fluoro-3-hydroxybenzoylamino)ethylamino)purine via reaction with O-benzotriazol-1-yl)-N,N,N′,N′-tetramethyluronium hexafluorophosphate (HBTU) and 6-((2-ammonium trifluoroacetate)ethylamino)purine.
2. 6-(12-(N-4-fluoro-3-hydroxybenzoylamino)dodecylamino)purine via reaction with O-benzotriazol-1-yl)-N,N,N′,N′-tetramethyluronium hexafluorophosphate (HBTU) and 6-((12-ammonium trifluoroacetate)dodecylamino)purine.
3. 6-(12-(N-4-fluoro-3-hydroxybenzoylamino)dodecylamino)purine via reaction with O-benzotriazol-1-yl)-N,N,N′,N′-tetramethyluronium hexafluorophosphate (HBTU) and 6-((12-ammonium trifluoroacetate)dodecylamino)purine.
4. 2-chloro-6-(12-(N-4-fluoro-3-hydroxybenzoylamino)dodecylamino)purine via reaction with O-benzotriazol-1-yl)-N,N,N′,N′-tetramethyluronium hexafluorophosphate (HBTU) and 2-chloro-6-((12-ammonium trifluoroacetate)dodecylamino)purine.
5. 12-N-boc-1-N-(4-fluoro-3-hydroxybenzoyl)diaminododecane via reaction with O-benzotriazol-1-yl)-N,N,N′,N′-tetramethyluronium hexafluorophosphate (HBTU) and N-boc-1,12-diaminododecane.
These synthesized compounds have the potential to be used as therapeutic agents in the treatment of various medical conditions, making 4-fluoro-3-hydroxybenzoic acid a valuable compound in the pharmaceutical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 51446-31-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,1,4,4 and 6 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 51446-31:
(7*5)+(6*1)+(5*4)+(4*4)+(3*6)+(2*3)+(1*1)=102
102 % 10 = 2
So 51446-31-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H5FO3/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,9H,(H,10,11)/p-1
51446-31-2Relevant articles and documents
Carbamoyloxy derivatives of mutiline and their use as antibacterials
-
, (2008/06/13)
PCT No. PCT/EP96/05874 Sec. 371 Date Dec. 4, 1998 Sec. 102(e) Date Dec. 4, 1998 PCT Filed Dec. 19, 1996 PCT Pub. No. WO97/25309 PCT Pub. Date Jul. 17, 1997Derivatives of mutiline of formula (1A) and pharmaceutically acceptable salts and derivatives thereof, in which R1 is ethyl or vinyl, Y is a carbamoyloxy group, in which the N-atom is unsubstituted, or mono- or di-substituted, are useful in the treatment of bacterial infections.
