51584-17-9 Usage
General Description
1-Methylindole-3-acetonitrile is a chemical compound with the molecular formula C11H9N. It is a derivative of indole, containing a methyl group and an acetonitrile group. 1-Methylindole-3-acetonitrile has been studied for its potential applications in organic synthesis and pharmaceutical research. It is also known to possess certain biological activities, such as being a substrate for the enzyme indoleamine 2,3-dioxygenase, which plays a role in regulating immune response. 1-Methylindole-3-acetonitrile has been investigated for its potential use in the development of new drugs and as a building block in the synthesis of organic compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 51584-17-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,1,5,8 and 4 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 51584-17:
(7*5)+(6*1)+(5*5)+(4*8)+(3*4)+(2*1)+(1*7)=119
119 % 10 = 9
So 51584-17-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H10N2/c1-13-8-9(6-7-12)10-4-2-3-5-11(10)13/h2-5,8H,6H2,1H3
