52547-00-9 Usage
Description
5-AMINO-3-METHYLISOTHIAZOLE HYDROCHLORIDE is a white to light yellow crystalline powder that is utilized in the field of pharmaceuticals and biochemistry. It serves as a crucial precursor in the synthesis of various compounds with potential applications in the medical industry.
Uses
Used in Pharmaceutical Industry:
5-AMINO-3-METHYLISOTHIAZOLE HYDROCHLORIDE is used as a precursor for the development of several pharmacological agents, including:
1. MMP12 inhibitors: These inhibitors are designed to target and regulate the activity of Matrix Metalloproteinase 12, an enzyme involved in various physiological processes and diseases. By modulating MMP12 activity, these inhibitors can potentially be used to treat conditions such as inflammatory diseases, cancer, and tissue remodeling disorders.
2. Aurora kinase inhibitors: Aurora kinases are a family of serine/threonine protein kinases that play a significant role in cell division and regulation of the cell cycle. Inhibitors of Aurora kinases are being investigated for their potential use in treating cancer, as they can disrupt the uncontrolled cell division and proliferation associated with tumor growth.
3. N-Heterocyclic indolyl glyoxylamides as anticancer agents: These compounds are synthesized using 5-AMINO-3-METHYLISOTHIAZOLE HYDROCHLORIDE as a starting material. They have shown potential in targeting cancer cells and inhibiting their growth, making them a promising avenue for the development of novel anticancer therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 52547-00-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,5,4 and 7 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 52547-00:
(7*5)+(6*2)+(5*5)+(4*4)+(3*7)+(2*0)+(1*0)=109
109 % 10 = 9
So 52547-00-9 is a valid CAS Registry Number.
InChI:InChI=1/C4H6N2S.ClH/c1-3-2-4(5)7-6-3;/h2H,5H2,1H3;1H
