5427-92-9 Usage
General Description
Ethyl 3-cyano-2-hydroxy-6-methyl-5-nitroisonicotinate is a chemical compound with the molecular formula C13H12N4O6. It is a derivative of isonicotinic acid that contains a cyano group, a hydroxy group, a methyl group, and a nitro group. ethyl 3-cyano-2-hydroxy-6-methyl-5-nitroisonicotinate is commonly used in the synthesis of pharmaceuticals and agrochemicals due to its potential biological activities. Additionally, it has been studied for its potential anti-inflammatory, antioxidant, and antitumor properties. Ethyl 3-cyano-2-hydroxy-6-methyl-5-nitroisonicotinate may also have other applications in the field of medicinal chemistry and drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 5427-92-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,2 and 7 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 5427-92:
(6*5)+(5*4)+(4*2)+(3*7)+(2*9)+(1*2)=99
99 % 10 = 9
So 5427-92-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H9N3O5/c1-3-18-10(15)7-6(4-11)9(14)12-5(2)8(7)13(16)17/h3H2,1-2H3,(H,12,14)