637031-88-0 Usage
Description
3,3-Difluorocyclobutanol is an organic compound that serves as a crucial starting material and building block in the synthesis of various pharmaceuticals. Its unique chemical structure, featuring two fluorine atoms attached to a cyclobutanol ring, endows it with specific properties that make it valuable in the development of different medications.
Uses
Used in Pharmaceutical Industry:
3,3-Difluorocyclobutanol is used as a starting material for the synthesis of various pharmaceuticals due to its unique chemical structure and reactivity. The presence of fluorine atoms in the molecule enhances its lipophilicity, which can improve the drug's ability to cross cell membranes and increase its bioavailability. Additionally, the cyclobutanol ring provides a versatile scaffold for further chemical modifications, allowing the development of a wide range of therapeutic agents.
Used in Anticancer Applications:
In the field of oncology, 3,3-difluorocyclobutanol is employed as a key intermediate in the development of anticancer drugs. Its unique structure allows for the creation of compounds that can target specific cancer-related pathways, potentially leading to the development of more effective and targeted cancer treatments.
Used in Drug Delivery Systems:
3,3-Difluorocyclobutanol can also be utilized in the design and development of drug delivery systems. Its chemical properties can be exploited to enhance the solubility, stability, and targeted delivery of therapeutic agents, ultimately improving their efficacy and reducing side effects.
Check Digit Verification of cas no
The CAS Registry Mumber 637031-88-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,3,7,0,3 and 1 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 637031-88:
(8*6)+(7*3)+(6*7)+(5*0)+(4*3)+(3*1)+(2*8)+(1*8)=150
150 % 10 = 0
So 637031-88-0 is a valid CAS Registry Number.
InChI:InChI=1S/C4H6F2O/c5-4(6)1-3(7)2-4/h3,7H,1-2H2
637031-88-0Relevant articles and documents
Multigram Synthesis of C 4/C5 3,3-Difluorocyclobutyl-Substituted Building Blocks
Melnykov, Kostiantyn P.,Granat, Dmitriy S.,Volochnyuk, Dmitriy M.,Ryabukhin, Sergey V.,Grygorenko, Oleksandr O.
, p. 4949 - 4957 (2018/12/13)
An approach for the multigram synthesis of 3,3-difluorocyclobutyl-substituted building blocks (including carboxylic acid, amines, alcohols, azide, trifluoroborate ketone) is described. It is shown that, in most cases, ethyl 3,3-difluorocyclobutanecarboxylate is a convenient common synthetic intermediate to obtain the target derivatives. For preparation of 3,3-difluorocyclobutanol or -cyclobutanone, an alternative pathway via reaction of dichloroketene and tert -butyl or benzyl vinyl ether should be applied.