644-80-4 Usage
Description
(Z)-Bromofumaric acid, with the molecular formula C4H3BrO4, is a chemical compound derived from fumaric acid, featuring a bromine atom attached to one of the carbon atoms in the double bond. This unique structure and reactivity make it a significant compound in the realm of organic chemistry.
Uses
Used in Organic Synthesis:
(Z)-Bromofumaric acid is used as a reagent and intermediate for the preparation of other organic compounds, playing a crucial role in the synthesis process due to its distinctive chemical properties.
Used in Pharmaceutical and Agrochemical Industries:
(Z)-Bromofumaric acid serves as a valuable building block for the synthesis of pharmaceuticals and agrochemicals, contributing to the development of new drugs and agricultural products.
Used in Research Studies:
(Z)-Bromofumaric acid is utilized in research studies and experiments to explore its potential biological and chemical properties, furthering the understanding of its applications and implications in various scientific fields.
Check Digit Verification of cas no
The CAS Registry Mumber 644-80-4 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 6,4 and 4 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 644-80:
(5*6)+(4*4)+(3*4)+(2*8)+(1*0)=74
74 % 10 = 4
So 644-80-4 is a valid CAS Registry Number.
InChI:InChI=1/C4H3BrO4/c5-2(4(8)9)1-3(6)7/h1H,(H,6,7)(H,8,9)/b2-1-
