64882-65-1 Usage
Description
2,3-DIHYDRO-3-OXO-4-PYRIDAZINECARBONITRILE, also known as 3-Oxo-2,3-dihydropyridazine-4-carbonitrile, is an organic compound that serves as a key intermediate in the synthesis of various pyridazine derivatives. It is characterized by its unique structure, which includes a 2,3-dihydropyridazine ring with a carbonitrile group at the 4-position and a ketone group at the 3-position. 2,3-DIHYDRO-3-OXO-4-PYRIDAZINECARBONITRILE plays a crucial role in the development of pharmaceuticals and other chemical applications due to its versatile reactivity and functional groups.
Uses
Used in Pharmaceutical Industry:
2,3-DIHYDRO-3-OXO-4-PYRIDAZINECARBONITRILE is used as a reactant in the preparation of pyridazines for the development of pharmaceutical compounds. Pyridazines are known for their wide range of biological activities, including anti-inflammatory, antiplatelet, and antimicrobial properties. The synthesis of these pyridazine derivatives allows for the exploration of new drug candidates with potential therapeutic applications.
Used in Chemical Synthesis:
In the field of chemical synthesis, 2,3-DIHYDRO-3-OXO-4-PYRIDAZINECARBONITRILE is used as a versatile building block for the creation of various pyridazine-containing compounds. Its reactivity allows for cyclization, ring transformation, aromatization, and substituent modification, enabling the synthesis of a diverse range of pyridazine derivatives with different functional groups and properties. These synthesized compounds can be further utilized in various applications, such as agrochemicals, dyes, and other specialty chemicals.
Overall, 2,3-DIHYDRO-3-OXO-4-PYRIDAZINECARBONITRILE is a valuable compound in the fields of pharmaceuticals and chemical synthesis, offering a wide range of applications due to its unique structure and reactivity. Its use as a reactant in the preparation of pyridazines opens up opportunities for the development of new drugs and other chemical products with potential benefits across various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 64882-65-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,4,8,8 and 2 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 64882-65:
(7*6)+(6*4)+(5*8)+(4*8)+(3*2)+(2*6)+(1*5)=161
161 % 10 = 1
So 64882-65-1 is a valid CAS Registry Number.
InChI:InChI=1/C5H3N3O/c6-3-4-1-2-7-8-5(4)9/h1-2H,(H,8,9)
64882-65-1Relevant articles and documents
NOVEL AZA-PYRIDOPYRIMIDINONE DERIVATIVES
-
Page/Page column 18, (2008/12/08)
The invention is concerned with novel aza-pyridopyrimidinone derivatives of formula (I): wherein R1, R2, R3, R4, R5, X1, X2, X3, Y, Z, m and n are as defined in the description and in the claims, as well as physiologically acceptable salts and esters thereof. These compounds are HM74A agonists and can be used in treating or preventing diseases which are modulated by HM74A agonists.
