65897-66-7 Usage
Description
1-(5-Chloro-2-hydroxyphenyl)-1,3-butanedione, also known as 1-(5-chloro-2-hydroxyphenyl)butane-1,3-dione, is a 1-aryl-1,3-dicarbonyl derivative. It is an organic compound characterized by its unique chemical structure, which includes a chlorinated phenyl group and a butanedione moiety. 1-(5-CHLORO-2-HYDROXYPHENYL)1 3-BUTANED& has potential applications in various industries due to its distinct chemical properties.
Uses
Used in Pharmaceutical Industry:
1-(5-Chloro-2-hydroxyphenyl)-1,3-butanedione is used as an intermediate compound for the synthesis of various pharmaceuticals. Its unique structure allows it to be a key component in the development of new drugs, particularly those targeting specific biological pathways or receptors.
Used in Chemical Synthesis:
In the field of organic chemistry, 1-(5-chloro-2-hydroxyphenyl)butane-1,3-dione is used as a building block for the synthesis of more complex molecules. Its reactivity and functional groups make it a valuable starting material for creating a wide range of chemical products, including dyes, pigments, and other specialty chemicals.
Used in Material Science:
1-(5-CHLORO-2-HYDROXYPHENYL)1 3-BUTANED&'s unique structure also makes it a candidate for use in material science, where it could be employed in the development of new polymers or other advanced materials with specific properties, such as improved strength, flexibility, or thermal stability.
Used in Research and Development:
1-(5-Chloro-2-hydroxyphenyl)-1,3-butanedione is also used in research and development settings, where it can serve as a model compound for studying various chemical reactions and mechanisms. Its unique properties make it an interesting subject for exploring new synthetic routes, reaction pathways, and potential applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 65897-66-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,5,8,9 and 7 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 65897-66:
(7*6)+(6*5)+(5*8)+(4*9)+(3*7)+(2*6)+(1*6)=187
187 % 10 = 7
So 65897-66-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H9ClO3/c1-6(12)4-10(14)8-5-7(11)2-3-9(8)13/h2-3,5,13H,4H2,1H3
65897-66-7Relevant articles and documents
Benzopyrans : Part 40 - Alumina mediated transformations of 4-oxo-4H-1- benzopyran-3-carbaldehyde, -3-carboxylic acid and their 2-methylhomologues
Ghosh, Chandra Kanta,Bhattacharyya, Samita
, p. 166 - 172 (2007/10/03)
In contact with alumina, the title aldehyde 1 (R = H, Me, Cl) gives the chromones 5 and 9,12 whereas the acid 2 affords the chromones 7, 10 and acetophenone 23. Alumina converts the aldehyde 3 to the xanthone 14, and the corresponding acid 4 to the chromone 8 and diketone 24.
