66432-63-1 Usage
Description
Tetrahydropyranylphytol, also known as THPP, is a chemical compound that serves as an intermediate in the synthesis of various organic compounds. It is characterized by its unique structure and reactivity, making it a valuable component in the chemical industry.
Uses
Used in the Chemical Industry:
Tetrahydropyranylphytol is used as an intermediate for the preparation of Neophytadiene, a key compound in the synthesis of various pharmaceuticals and other organic molecules. Its role in the production of Neophytadiene highlights its importance in the development of new and innovative products in the chemical and pharmaceutical sectors.
Check Digit Verification of cas no
The CAS Registry Mumber 66432-63-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,6,4,3 and 2 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 66432-63:
(7*6)+(6*6)+(5*4)+(4*3)+(3*2)+(2*6)+(1*3)=131
131 % 10 = 1
So 66432-63-1 is a valid CAS Registry Number.
InChI:InChI=1/C25H48O2/c1-21(2)11-8-12-22(3)13-9-14-23(4)15-10-16-24(5)18-20-27-25-17-6-7-19-26-25/h18,21-23,25H,6-17,19-20H2,1-5H3/b24-18+/t22-,23-,25?/m1/s1