7252-58-6 Usage
Description
[1-(4-ethoxyphenyl)ethylideneamino]urea is a chemical compound with the molecular formula C11H15N3O2. It is a urea derivative featuring an ethoxyphenyl group attached to the amino group. [1-(4-ethoxyphenyl)ethylideneamino]urea holds potential in medicinal chemistry due to its pharmacological properties, making it a promising candidate for drug development, particularly in the areas of antimicrobial and antitumor agents. Further research is necessary to fully understand its biological activity and potential therapeutic applications.
Uses
Used in Pharmaceutical Industry:
[1-(4-ethoxyphenyl)ethylideneamino]urea is used as a precursor in the synthesis of various pharmaceutical compounds for its potential antimicrobial and antitumor properties. Its unique structure allows for the development of new drugs that could target specific pathogens or cancer cells more effectively.
Used in Antimicrobial Applications:
In the field of antimicrobial agents, [1-(4-ethoxyphenyl)ethylideneamino]urea is used as a key component in the development of new antibiotics. Its structure enables it to potentially disrupt bacterial cell functions, inhibiting growth and leading to the eradication of harmful microorganisms.
Used in Antitumor Applications:
[1-(4-ethoxyphenyl)ethylideneamino]urea is also used as a building block for the creation of antitumor drugs. Its potential to interfere with cancer cell metabolism and division makes it a valuable compound in the fight against various types of cancer.
Further research and development are required to optimize the synthesis and application of [1-(4-ethoxyphenyl)ethylideneamino]urea in these areas, ensuring its safety and efficacy as a pharmaceutical compound.
Check Digit Verification of cas no
The CAS Registry Mumber 7252-58-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,2,5 and 2 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 7252-58:
(6*7)+(5*2)+(4*5)+(3*2)+(2*5)+(1*8)=96
96 % 10 = 6
So 7252-58-6 is a valid CAS Registry Number.
InChI:InChI=1/C11H15N3O2/c1-3-16-10-6-4-9(5-7-10)8(2)13-14-11(12)15/h4-7H,3H2,1-2H3,(H3,12,14,15)/b13-8+
7252-58-6Relevant articles and documents
Synthesis of 3-substituted arylpyrazole-4-carboxylic acids
Lebedev,Lebedeva,Sheludyakov,Kovaleva,Ustinova,Kozhevnikov
, p. 782 - 789 (2007/10/03)
A method was suggested for preparing previously unknown 3-aryl-substituted pyrazole-4-carboxylic acids, involving Vilsmeier formylation of semicarbazones of 26 available mono- and disubstituted acetophenones and 2-acetylthiophene followed by oxidation of
