74420-51-2 Usage
General Description
5-Bromo-2-methylimidazo[1,2-a]pyridine is a chemical compound with the formula C?H?BrN?. It is a heterocyclic compound that contains both nitrogen and bromine atoms in its structure. This chemical is commonly used in chemical research and drug development as a building block for various compounds. It is also known to have mutagenic and carcinogenic properties, making it a subject of interest in toxicological studies and risk assessments. Additionally, it is considered a potential environmental contaminant due to its presence in certain industrial processes and is regulated for its potential impact on human health and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 74420-51-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,4,4,2 and 0 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 74420-51:
(7*7)+(6*4)+(5*4)+(4*2)+(3*0)+(2*5)+(1*1)=112
112 % 10 = 2
So 74420-51-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H7BrN2/c1-6-5-11-7(9)3-2-4-8(11)10-6/h2-5H,1H3
74420-51-2Relevant articles and documents
BICYCLIC COMPOUND AND PHARMACEUTICAL USE THEREOF
-
Page/Page column 93, (2010/01/29)
The present invention provides a compound represented by the formula wherein R1 is a hydrocarbon group optionally having substituent(s), amino optionally having substituent(s), hydroxy optionally having a substituent or a heterocyclic group optionally having substituent(s); R2 is a hydrogen atom or a hydrocarbon group optionally having substituent(s); Xa and Xb are each C, N, O or S; Xc and Xd are each C or N; m is 0-2; n is 1-3; ring A is a 5-membered ring optionally having substituent(s); ring B is a 6-membered ring optionally having substituent(s); and ring C is a 3- to 5-membered ring optionally having substituent(s), provided that when Xa, Xc and Xd are each C, then Xb is N or S, or a salt thereof, which is useful as an agent for the prophylaxis or treatment of a disease relating to an action of melatonin, and the like.
