7465-66-9 Usage
General Description
1-Methyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinecarbonitrile is a chemical compound with the molecular formula C6H6N4O2. It is a pyrimidine derivative, which is a heterocyclic organic compound containing a ring structure with two nitrogen atoms and four carbon atoms. 1-METHYL-2,4-DIOXO-1,2,3,4-TETRAHYDRO-5-PYRIMIDINECARBONITRILE is commonly used in organic synthesis and pharmaceutical research as it can serve as a precursor for the synthesis of various pharmaceuticals and bioactive compounds. It is also known to have medicinal properties, such as antiviral and antibacterial activity, making it a potential candidate for drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 7465-66-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,4,6 and 5 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 7465-66:
(6*7)+(5*4)+(4*6)+(3*5)+(2*6)+(1*6)=119
119 % 10 = 9
So 7465-66-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H5N3O2/c1-9-3-4(2-7)5(10)8-6(9)11/h3H,1H3,(H,8,10,11)