7467-92-7 Usage
General Description
6-Quinoxalinol, 1,4-dioxide is a chemical compound with the molecular formula C8H6N2O2. It is a heterocyclic compound containing a quinoxaline ring with hydroxyl and dioxide functional groups attached. 6-Quinoxalinol, 1,4-dioxide is used in organic synthesis and pharmaceuticals, and it also exhibits biological activity as an antimicrobial and anticancer agent. Additionally, 6-Quinoxalinol, 1,4-dioxide has been studied for its potential applications in materials science, specifically in the development of organic semiconductors and optoelectronic devices. Its unique structure and versatile properties make it an important compound in various fields of chemistry and technology.
Check Digit Verification of cas no
The CAS Registry Mumber 7467-92-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,4,6 and 7 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 7467-92:
(6*7)+(5*4)+(4*6)+(3*7)+(2*9)+(1*2)=127
127 % 10 = 7
So 7467-92-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H5N2O3/c11-6-1-2-7-8(5-6)10(13)4-3-9(7)12/h1-5H/q+1/p+1
