7478-72-0 Usage
General Description
2,4'-Dichlorobenzophenone (2,4-dinitrophenyl)hydrazone is a chemical compound derived from benzophenone and hydrazine. It is commonly used in organic synthesis and as a reagent for the detection and quantification of carbonyl compounds, such as aldehydes and ketones. The compound is known for its yellow crystalline appearance and is often used in analytical chemistry for the identification and characterization of aldehydes and ketones based on their specific reactions with the hydrazone. Additionally, it has been used in pharmaceutical and medicinal research due to its potential as an anti-inflammatory and anti-cancer agent.
Check Digit Verification of cas no
The CAS Registry Mumber 7478-72-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,4,7 and 8 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 7478-72:
(6*7)+(5*4)+(4*7)+(3*8)+(2*7)+(1*2)=130
130 % 10 = 0
So 7478-72-0 is a valid CAS Registry Number.
InChI:InChI=1/C19H12Cl2N4O4/c20-13-7-5-12(6-8-13)19(15-3-1-2-4-16(15)21)23-22-17-10-9-14(24(26)27)11-18(17)25(28)29/h1-11,22H/b23-19+