777-59-3 Usage
Nitrosourea derivative
A type of chemical compound that contains a nitroso group (-NO) and a urea group (-NH2-CO-NH2) This classification indicates the presence of specific functional groups in the molecule that contribute to its chemical properties and potential biological activity.
Anticancer agent
Potential to inhibit the growth of tumor cells The compound has demonstrated the ability to interfere with the growth and proliferation of cancer cells, making it a potential candidate for cancer treatment.
Chemotherapy application
Particularly effective in the treatment of brain tumors and other solid tumors The compound has shown promise in targeting specific types of cancer, such as brain and solid tumors, which may make it a valuable addition to existing cancer treatments.
Mechanism of action
Interferes with DNA replication and repair processes in cancer cells, leading to cell death The compound works by disrupting the cancer cells' ability to replicate their DNA and repair any damage, ultimately causing the cells to die and slowing or stopping tumor growth.
Need for further research
To understand its full therapeutic potential and any potential side effects While 1-Methyl-1-nitroso-3-(4-fluorophenyl)urea has shown promise as an anticancer agent, more studies are needed to fully explore its capabilities and ensure its safety and efficacy in clinical settings.
Check Digit Verification of cas no
The CAS Registry Mumber 777-59-3 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 7,7 and 7 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 777-59:
(5*7)+(4*7)+(3*7)+(2*5)+(1*9)=103
103 % 10 = 3
So 777-59-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H8FN3O2/c1-12(11-14)8(13)10-7-4-2-6(9)3-5-7/h2-5H,1H3,(H,10,13)
