7770-52-7 Usage
Molecular structure
2-(4-cyclohexylphenyl)-6-methyl-3-nitroso-indolizine has a complex molecular structure, featuring a cyclohexylphenyl group attached to an indolizine ring.
Functional groups
The compound contains a nitroso group (-NO) and a methyl group (-CH3) as its main functional groups.
Nitroso derivative
It is a nitroso derivative of an indolizine, which means it has a potential for biological and pharmacological activities.
Functional properties
The presence of the nitroso and methyl groups give the compound its specific functional properties.
Potential applications
Due to its potential biological and pharmacological activities, 2-(4-cyclohexylphenyl)-6-methyl-3-nitroso-indolizine is a promising candidate for further research and development in the fields of medicine and chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 7770-52-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,7,7 and 0 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 7770-52:
(6*7)+(5*7)+(4*7)+(3*0)+(2*5)+(1*2)=117
117 % 10 = 7
So 7770-52-7 is a valid CAS Registry Number.
InChI:InChI=1/C21H22N2O/c1-15-7-12-19-13-20(21(22-24)23(19)14-15)18-10-8-17(9-11-18)16-5-3-2-4-6-16/h7-14,16H,2-6H2,1H3