81863-61-8 Usage
Chemical class
Thiosemicarbazide derivatives
Molar mass
365.88 g/mol
Application
Medicinal chemistry and pharmaceutical research
Potential pharmacological properties
Anti-cancer and antimicrobial agent
Presence of functional groups
Chlorophenylthio and phenylthio groups
Significance
Potential biological activities and interest in the development of new drugs and treatments
Check Digit Verification of cas no
The CAS Registry Mumber 81863-61-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,1,8,6 and 3 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 81863-61:
(7*8)+(6*1)+(5*8)+(4*6)+(3*3)+(2*6)+(1*1)=148
148 % 10 = 8
So 81863-61-8 is a valid CAS Registry Number.
InChI:InChI=1/C15H14ClN3OS2/c16-11-6-8-13(9-7-11)22-10-14(20)18-19-15(21)17-12-4-2-1-3-5-12/h1-9H,10H2,(H,18,20)(H2,17,19,21)