82585-90-8 Usage
General Description
The chemical "5-Amino-1,2-dihydro-3-(((4-methoxyphenyl)methylamino)methyl)pyrido (- 3,4-b)pyrazin-7-yl)-, carbamic acid, ethyl ester" is a compound with a complex molecular structure that includes an amino group, a dihydropyrido ring system, a carbamic acid moiety, and an ethyl ester functional group. (5-Amino-1,2-dihydro-3-(((4-methoxyphenyl)methylamino)methyl)pyrido (- 3,4-b)pyrazin-7-yl)-, carbamic acid, ethyl ester has potential applications in pharmaceuticals or drug development due to its structural features and functional groups which can interact with biological targets. The presence of the amino group and the pyrido ring system suggests that this compound may have potential biological activity, while the carbamic acid and ethyl ester groups can confer specific chemical properties such as solubility or bioavailability. Further research and investigation are necessary to determine the specific uses and potential effects of this compound.
Check Digit Verification of cas no
The CAS Registry Mumber 82585-90-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,2,5,8 and 5 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 82585-90:
(7*8)+(6*2)+(5*5)+(4*8)+(3*5)+(2*9)+(1*0)=158
158 % 10 = 8
So 82585-90-8 is a valid CAS Registry Number.
InChI:InChI=1/C19H24N6O3/c1-4-28-19(26)24-16-9-15-17(18(20)23-16)22-12(10-21-15)11-25(2)13-5-7-14(27-3)8-6-13/h5-9,21H,4,10-11H2,1-3H3,(H3,20,23,24,26)
82585-90-8Relevant articles and documents
1,2-dihydropyrido[3,4-b]pyrazines
-
, (2008/06/13)
1,2-Dihydropyrido[3,4-b]pyrazines are provided which possess anticancer activity. The compounds have the structure: STR1 wherein Y is CH2 or N(CH3); R1 is a lower alkyl group; e.g., an alkyl group containing up to six carb