94271-08-6 Usage
Description
2-styryl-4-ethoxymethylene-5-oxazolone is a 1,3-oxazole compound characterized by a beta-styryl substituent at the 2-position, an ethoxymethylene group at the 4-position, and an oxo group at the 5-position. It is a heterocyclic organic compound with a unique structure that may exhibit various chemical and biological properties.
Uses
Used in Pharmaceutical Industry:
2-styryl-4-ethoxymethylene-5-oxazolone is used as a pharmaceutical intermediate for the synthesis of various drug candidates. Its unique structure allows it to be a versatile building block in the development of new therapeutic agents with potential applications in treating various diseases.
Used in Chemical Research:
In the field of chemical research, 2-styryl-4-ethoxymethylene-5-oxazolone serves as a valuable compound for studying the properties and reactivity of 1,3-oxazoles and their derivatives. It can be used to explore new synthetic routes, reaction mechanisms, and the influence of its substituents on the overall chemical behavior.
Used in Material Science:
2-styryl-4-ethoxymethylene-5-oxazolone may also find applications in material science, particularly in the design and synthesis of novel materials with specific properties. Its incorporation into polymers, for instance, could lead to the development of new materials with improved characteristics, such as enhanced stability, reactivity, or selectivity.
Check Digit Verification of cas no
The CAS Registry Mumber 94271-08-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,4,2,7 and 1 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 94271-08:
(7*9)+(6*4)+(5*2)+(4*7)+(3*1)+(2*0)+(1*8)=136
136 % 10 = 6
So 94271-08-6 is a valid CAS Registry Number.
InChI:InChI=1/C14H13NO3/c1-2-17-10-12-14(16)18-13(15-12)9-8-11-6-4-3-5-7-11/h3-10H,2H2,1H3/b9-8+,12-10+
