CasNo.14639-97-5,Zinc ammonium chloride,(14639-97-5) Suppliers

0 Metric Ton	Negotiable

Min.Order :0 Metric Ton
Purity: 99
Payment Terms : T/T

Keywords

Ammonium tetrachlorozincate(2-) Ammoniumchlorozincate ((NH4)2[ZnCl4]) (6CI) Ammonium zincchloride (2NH4Cl.ZnCl2)

Quick Details

Appearance:
Application:This chemical is called Ammonium tetrachlorozincate, and its CAS registry number is 14639-97-5. With the molecular formula of Cl4H8N2Zn, its molecular weight is 243.27. Additionally, its product cate
PackAge:
ProductionCapacity:|Metric Ton|Day
Storage:
Transportation:This chemical is called Ammonium tetrachlorozincate, and its CAS registry number is 14639-97-5. With the molecular formula of Cl4H8N2Zn, its molecular weight is 243.27. Additionally, its product cate

Superiority:

This chemical is called Ammonium tetrachlorozincate, and its CAS registry number is 14639-97-5. With the molecular formula of Cl₄H₈N₂Zn, its molecular weight is 243.27. Additionally, its product category is Inorganics.

Other characteristics of the Ammonium tetrachlorozincate can be summarised as followings: (1)#H bond acceptors: 0; (2)#H bond donors: 0; (3)#Freely Rotating Bonds: 0; (4)Polar Surface Area: 0 Å².

You can still convert the following datas into molecular structure:
1.SMILES: Cl[Zn-2](Cl)(Cl)Cl.[NH4+].[NH4+]
2.InChI: InChI=1/4ClH.2H3N.Zn/h4*1H;2*1H3;/q;;;;;;+2/p-2/rCl4Zn.2H3N/c1-5(2,3)4;;/h;2*1H3/q-2;;/p+2
3.InChIKey: QOQUXKCHSZSKOT-RVZGQXSSAV

Details:

This chemical is called Ammonium tetrachlorozincate, and its CAS registry number is 14639-97-5. With the molecular formula of Cl₄H₈N₂Zn, its molecular weight is 243.27. Additionally, its product category is Inorganics.

Other characteristics of the Ammonium tetrachlorozincate can be summarised as followings: (1)#H bond acceptors: 0; (2)#H bond donors: 0; (3)#Freely Rotating Bonds: 0; (4)Polar Surface Area: 0 Å².

You can still convert the following datas into molecular structure:
1.SMILES: Cl[Zn-2](Cl)(Cl)Cl.[NH4+].[NH4+]
2.InChI: InChI=1/4ClH.2H3N.Zn/h4*1H;2*1H3;/q;;;;;;+2/p-2/rCl4Zn.2H3N/c1-5(2,3)4;;/h;2*1H3/q-2;;/p+2
3.InChIKey: QOQUXKCHSZSKOT-RVZGQXSSAV