Acetamide,N-(2,3-dihydro-1H-inden-1-yl)-

Superiority:

The Acetamide,N-(2,3-dihydro-1H-inden-1-yl)- is an organic compound with the formula C₁₁H₁₃NO. The IUPAC name of this chemical is N-(2,3-dihydro-1H-inden-1-yl)acetamide. With the CAS registry number 10408-91-0, it is also named as N-Indan-1-yl-acetamide. In addition, the molecular weight is 175.22702.

The other characteristics of Acetamide,N-(2,3-dihydro-1H-inden-1-yl)- can be summarized as: (1)ACD/LogP: 2.00; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2; (4)ACD/LogD (pH 7.4): 2; (5)ACD/BCF (pH 5.5): 19.64; (6)ACD/BCF (pH 7.4): 19.64; (7)ACD/KOC (pH 5.5): 293.21; (8)ACD/KOC (pH 7.4): 293.21; (9)#H bond acceptors: 2; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 1; (12)Index of Refraction: 1.564; (13)Molar Refractivity: 51.59 cm³; (14)Molar Volume: 158.5 cm³; (15)Polarizability: 20.45×10^-24 cm³; (16)Surface Tension: 42.1 dyne/cm; (17)Enthalpy of Vaporization: 61.94 kJ/mol; (18)Vapour Pressure: 9.72E-06 mmHg at 25°C; (19)Rotatable Bond Count: 1; (20)Tautomer Count: 2; (21)Exact Mass: 175.099714; (22)MonoIsotopic Mass: 175.099714; (23)Topological Polar Surface Area: 29.1; (24)Heavy Atom Count: 13; (25)Complexity: 202.

People can use the following data to convert to the molecule structure. 
1. SMILES:O=C(NC2c1ccccc1CC2)C
2. InChI:InChI=1/C11H13NO/c1-8(13)12-11-7-6-9-4-2-3-5-10(9)11/h2-5,11H,6-7H2,1H3,(H,12,13)
3. InChIKey:UOOXDDHYFFXMJJ-UHFFFAOYAW 
4. Std. InChI:InChI=1S/C11H13NO/c1-8(13)12-11-7-6-9-4-2-3-5-10(9)11/h2-5,11H,6-7H2,1H3,(H,12,13) 
5. Std. InChIKey:UOOXDDHYFFXMJJ-UHFFFAOYSA-N