1. Introduction ofN-Cbz-L-homoserine lactone (CAS No.:35677-89-5)
N-Cbz-L-homoserine lactone canalso be called N-((3R)-2-Oxo(3-3,4,5-trihydrofuryl))(phenylmethoxy)carbox
1. Introduction of N-Cbz-L-homoserine lactone (CAS No.:35677-89-5)
N-Cbz-L-homoserine lactone can also be called N-((3R)-2-Oxo(3-3,4,5-trihydrofuryl))(phenylmethoxy)carboxamide. The molecular formula is C12H13NO4 and molecular weight is 235.24
2. Properties of N-Cbz-L-homoserine lactone (CAS No.:35677-89-5)
Density: 1.27 g/cm3
Melting Point: 127-132 °C
Surface Tension: 50 dyne/cm
Flash Point: 235.7 °C
Enthalpy of Vaporization: 72.78 kJ/mol
Boiling Point: 466.1 °C at 760 mmHg
Vapour Pressure: 7.29E-09 mmHg at 25°C
3. Safety Information of N-Cbz-L-homoserine lactone (CAS No.:35677-89-5)
Safety Statements: 22-24/25
S22:Do not breathe dust.
S24/25:Avoid contact with skin and eyes.
WGK Germany: 3
F: 10
4. Structure Descriptors of N-Cbz-L-homoserine lactone (CAS No.:35677-89-5)
SMILES:c1cccc(c1)COC(=O)N[C@@H]1C(=O)OCC1
CAS NO:36727-29-4
CAS NO:40292-82-8
CAS NO:101623-69-2
CAS NO:50893-53-3
CAS NO:69888-89-7
CAS NO:6092-54-2
About|Contact|Cas|Product Name|Molecular|Country|Encyclopedia
Message|New Cas|MSDS|Service|Advertisement|CAS DataBase|Article Data|Manufacturers | Chemical Catalog
©2008 LookChem.com,License: ICP
NO.:Zhejiang16009103
complaints:service@lookchem.com Desktop View