1. Introduction of(2E)-3-(4-Biphenylyl)acrylic acid (CAS No.: 88241-65-0)
With the CAS registry number 88241-65-0, (2E)-3-(4-Biphenylyl)acrylic acid is also known as2-Pr
1. Introduction of (2E)-3-(4-Biphenylyl)acrylic acid (CAS No.: 88241-65-0)
With the CAS registry number 88241-65-0, (2E)-3-(4-Biphenylyl)acrylic acid is also known as 2-Propenoic acid,3-[1,1'-biphenyl]-4-yl-, (2E)-. This chemical's molecular formula is C15H12O2 and the molecular weight is 224.25.
2. Properties of (2E)-3-(4-Biphenylyl)acrylic acid (CAS No.: 88241-65-0)
Density: 1.178 g/cm3
Melting Point: 224-228 °C
Boiling Point: 412.912 °C at 760 mmHg
Flash Point: 308.021 °C
3. Structure Descriptors of (2E)-3-(4-Biphenylyl)acrylic acid (CAS No.: 88241-65-0)
(1) SMILES: O=C(O)\C=C\c2ccc(c1ccccc1)cc2
(2) InChI: InChI=1S/C15H12O2/c16-15(17)11-8-12-6-9-14(10-7-12)13-4-2-1-3-5-13/h1-11H,(H,16,17)/b11-8+
(3) InChIKey: DMJDEZUEYXVYNO-DHZHZOJOSA-N
CAS NO:36727-29-4
CAS NO:40292-82-8
CAS NO:101623-69-2
CAS NO:50893-53-3
CAS NO:69888-89-7
CAS NO:6092-54-2
About|Contact|Cas|Product Name|Molecular|Country|Encyclopedia
Message|New Cas|MSDS|Service|Advertisement|CAS DataBase|Article Data|Manufacturers | Chemical Catalog
©2008 LookChem.com,License: ICP
NO.:Zhejiang16009103
complaints:service@lookchem.com Desktop View