Min.Order / FOB Price:Get Latest Price
5 Metric Ton |
FOB Price:USD 1.0000 -2.0000 |
Methyl methylcarbamate N-Methyl Methylcarbamate 6642-30-4
Name | Methyl Methylcarbamate |
Synonyms | Methyl N-Methylcarbamate; N-Methyl Methylcarbamate; O-Methyl-N-Methylcarbamate |
CAS | 6642-30-4 |
EINECS | 229-661-5 |
Molecular formula | C3H7NO2 |
Molecular weight | 89.09 |
InChI | InChI=1S/C3H7NO2/c1-4-3(5)6-2/h1-2H3,(H,4,5) |
InChIKey | NYXHSRNBKJIQQG-UHFFFAOYSA-N |
Structural formula | |
Appearance | Colorless to light yellow liquid |
Content (GC) | ≥98.0% |
Name | Methyl Methylcarbamate |
Synonyms | Methyl N-Methylcarbamate; N-Methyl Methylcarbamate; O-Methyl-N-Methylcarbamate |
CAS | 6642-30-4 |
EINECS | 229-661-5 |
Molecular formula | C3H7NO2 |
Molecular weight | 89.09 |
InChI | InChI=1S/C3H7NO2/c1-4-3(5)6-2/h1-2H3,(H,4,5) |
InChIKey | NYXHSRNBKJIQQG-UHFFFAOYSA-N |
Structural formula | |
Appearance | Colorless to light yellow liquid |
Content (GC) | ≥98.0% |
CAS NO:14433-76-2
CAS NO:5292-43-3
CAS NO:71-23-8
CAS NO:97-90-5
CAS NO:61985-25-9
CAS NO:61985-25-9
About|Contact|Cas|Product Name|Molecular|Country|Encyclopedia
Message|New Cas|MSDS|Service|Advertisement|CAS DataBase|Article Data|Manufacturers | Chemical Catalog
©2008 LookChem.com,License: ICP
NO.:Zhejiang16009103
complaints:service@lookchem.com Desktop View