150536-01-9 Usage
Description
[5-(4-CHLOROPHENYL)-4-ETHYL-4H-1,2,4-TRIAZOL-3-YL]THIOACETIC ACID, with the molecular formula C12H12ClN3OS, is a chemical compound derived from 1,2,4-triazole and features a thioacetic acid group. [5-(4-CHLOROPHENYL)-4-ETHYL-4H-1,2,4-TRIAZOL-3-YL]THIOACETIC ACID is known for its potential applications in various industries, including agriculture and pharmaceuticals, due to its unique properties and chemical structure.
Uses
Used in Agricultural Industry:
[5-(4-CHLOROPHENYL)-4-ETHYL-4H-1,2,4-TRIAZOL-3-YL]THIOACETIC ACID is used as a fungicide for protecting crops from fungal diseases. It functions by inhibiting the growth of fungi and preventing the spread of fungal infections, ensuring a healthy and productive agricultural yield.
Used in Pharmaceutical Research:
In the pharmaceutical industry, [5-(4-chlorophenyl)-4-ethyl-4H-1,2,4-triazol-3-yl]thioacetic acid has been utilized in research studies to explore its potential as an anti-inflammatory and anti-cancer agent. Its unique chemical properties make it a promising candidate for the development of new drugs and therapies to address various health conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 150536-01-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,0,5,3 and 6 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 150536-01:
(8*1)+(7*5)+(6*0)+(5*5)+(4*3)+(3*6)+(2*0)+(1*1)=99
99 % 10 = 9
So 150536-01-9 is a valid CAS Registry Number.
InChI:InChI=1/C12H12ClN3O2S/c1-2-16-11(8-3-5-9(13)6-4-8)14-15-12(16)19-7-10(17)18/h3-6H,2,7H2,1H3,(H,17,18)/p-1
