The (R)-3-(3-Methylbutanoyl)-4-benzyloxazolidin-2-one is an organic compound with the formula C15H19NO3. The systematic name of this chemical is (4R)-4-benzyl-3-(3-methylbutanoyl)-1,3-oxazolidin-2-one. With the CAS registry number 145589-03-3, it is also named as (4R)-3-(3-Methyl-1-oxobutyl)-4-(phenylmethyl)-2-oxazolidinone. The molecular weight is 261.32.
The other characteristics of (R)-3-(3-Methylbutanoyl)-4-benzyloxazolidin-2-one can be summarized as: (1)ACD/LogP: 1.92; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.92; (4)ACD/LogD (pH 7.4): 1.92; (5)ACD/BCF (pH 5.5): 16.94; (6)ACD/BCF (pH 7.4): 16.94; (7)ACD/KOC (pH 5.5): 263.85; (8)ACD/KOC (pH 7.4): 263.85; (9)#H bond acceptors: 4; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 4; (12)Polar Surface Area: 46.61 Å2; (13)Index of Refraction: 1.541; (14)Molar Refractivity: 71.36 cm3; (15)Molar Volume: 226.7 cm3; (16)Polarizability: 28.29×10-24 cm3; (17)Surface Tension: 45.1 dyne/cm; (18)Density: 1.152 g/cm3; (19)Flash Point: 203.5 °C; (20)Enthalpy of Vaporization: 66.56 kJ/mol; (21)Boiling Point: 412.9 °C at 760 mmHg; (22)Vapour Pressure: 5E-07 mmHg at 25°C.
People can use the following data to convert to the molecule structure.
1. SMILES:O=C1OC[C@H](N1C(=O)CC(C)C)Cc2ccccc2
2. InChI:InChI=1/C15H19NO3/c1-11(2)8-14(17)16-13(10-19-15(16)18)9-12-6-4-3-5-7-12/h3-7,11,13H,8-10H2,1-2H3/t13-/m1/s1
3. InChIKey:JHGXEUXQJIKZMY-CYBMUJFWBT
4. Std. InChI:InChI=1S/C15H19NO3/c1-11(2)8-14(17)16-13(10-19-15(16)18)9-12-6-4-3-5-7-12/h3-7,11,13H,8-10H2,1-2H3/t13-/m1/s1
5. Std. InChIKey:JHGXEUXQJIKZMY-CYBMUJFWSA-N
About|Contact|Cas|Product Name|Molecular|Country|Encyclopedia
Message|New Cas|MSDS|Service|Advertisement|CAS DataBase|Article Data|Manufacturers | Chemical Catalog
©2008 LookChem.com,License: ICP
NO.:Zhejiang16009103
complaints:service@lookchem.com Desktop View