The IUPAC name of this chemical is 1-[chloro(phenyl)methyl]-4-fluorobenzene. With the CAS registry number 365-21-9 and EINECS 206-670-2, it is also named as Benzene, 1-(chlorophenylmethyl)-4-fluoro-. The formula is C13H10ClF and the molecular weight is 220.669903.
The other characteristics of 1-(Chlorophenylmethyl)-4-fluorobenzene can be summarized as: (1)ACD/LogP: 4.01; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 0; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 2; (6)Polar Surface Area: 0 Å2; (7)Index of Refraction: 1.566; (8)Molar Refractivity: 60.41 cm3; (9)Molar Volume: 185.1 cm3; (10)Polarizability: 23.94×10-24 cm3; (11)Surface Tension: 38.9 dyne/cm; (12)Enthalpy of Vaporization: 51.31 kJ/mol; (13)Boiling Point: 294.8 °C at 760 mmHg; (14)Vapour Pressure: 0.00279 mmHg at 25°C; (15)Rotatable Bond Count: 2; (16)Exact Mass: 220.045506; (17)MonoIsotopic Mass: 220.045506; (18)Heavy Atom Count: 15; (19)Complexity: 181; (20)Undefined Atom StereoCenter Count: 1.
People can use the following data to convert to the molecule structure.
1. SMILES:ClC(c1ccc(F)cc1)c2ccccc2
2. InChI:InChI=1/C13H10ClF/c14-13(10-4-2-1-3-5-10)11-6-8-12(15)9-7-11/h1-9,13H
3. InChIKey:GNFODANOHXAUPE-UHFFFAOYAS
4. Std. InChI:InChI=1S/C13H10ClF/c14-13(10-4-2-1-3-5-10)11-6-8-12(15)9-7-11/h1-9,13H
5. Std. InChIKey:GNFODANOHXAUPE-UHFFFAOYSA-N
About|Contact|Cas|Product Name|Molecular|Country|Encyclopedia
Message|New Cas|MSDS|Service|Advertisement|CAS DataBase|Article Data|Manufacturers | Chemical Catalog
©2008 LookChem.com,License: ICP
NO.:Zhejiang16009103
complaints:service@lookchem.com Desktop View