Z-D-LYS-OH

The CAS register number of Cbz-D-Lysine is 70671-54-4. It also can be called as (R)-6-Amino-2-(benzyloxycarbonylamino)hexanoic acid and the systematic name about this chemical is (2R)-6-ammonio-2-{[(benzyloxy)carbonyl]amino}hexanoate. The molecular formula about this chemical is C₁₄H₂₀N₂O₄ and the molecular weight is 280.32. It belongs to the following product categories, such as Amino Acids; Amino Acids (N-Protected); Biochemistry; Cbz-Amino Acids and so on.

Physical properties about Cbz-D-Lysine are: (1)ACD/LogP: 1.36; (2)ACD/LogD (pH 5.5): -1.15; (3)ACD/LogD (pH 7.4): -1.14; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 1; (7)ACD/KOC (pH 7.4): 1; (8)#H bond acceptors: 6; (9)#H bond donors: 4; (10)#Freely Rotating Bonds: 10; (11)Polar Surface Area: 66.84Ų; (12)Index of Refraction: 1.55; (13)Molar Refractivity: 74.02 cm³; (14)Molar Volume: 232.2 cm³; (15)Polarizability: 29.34x10^-24cm³; (16)Surface Tension: 51.9 dyne/cm; (17)Enthalpy of Vaporization: 80.55 kJ/mol; (18)Boiling Point: 497 °C at 760 mmHg; (19)Vapour Pressure: 1.07E-10 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: [O-]C(=O)[C@H](NC(=O)OCc1ccccc1)CCCC[NH3+]
(2)InChI: InChI=1/C14H20N2O4/c15-9-5-4-8-12(13(17)18)16-14(19)20-10-11-6-2-1-3-7-11/h1-3,6-7,12H,4-5,8-10,15H2,(H,16,19)(H,17,18)/t12-/m1/s1
(3)InChIKey: OJTJKAUNOLVMDX-GFCCVEGCBI
(4)Std. InChI: InChI=1S/C14H20N2O4/c15-9-5-4-8-12(13(17)18)16-14(19)20-10-11-6-2-1-3-7-11/h1-3,6-7,12H,4-5,8-10,15H2,(H,16,19)(H,17,18)/t12-/m1/s1
(5)Std. InChIKey: OJTJKAUNOLVMDX-GFCCVEGCSA-N