The Hydrazinecarboxamide,N-hydroxy- with CAS registry number of 21520-79-6 is also known as N-Hydroxy-1-hydrazinecarboxamide. The IUPAC name is 1-Amino-3-hydroxyurea. In addition, the formula is CH5N3O2 and the molecular weight is 91.07.
Physical properties about Hydrazinecarboxamide,N-hydroxy- are: (1)ACD/LogP: -1.55; (2)# of Rule of 5 Violations: 1; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 3.36; (6)ACD/KOC (pH 7.4): 3.38; (7)#H bond acceptors: 5; (8)#H bond donors: 5; (9)#Freely Rotating Bonds: 2; (10)Index of Refraction: 1.534; (11)Molar Refractivity: 18.97 cm3; (12)Molar Volume: 60.9 cm3; (13)Surface Tension: 73.7 dyne/cm; (14)Density: 1.493 g/cm3.
You can still convert the following datas into molecular structure:
1. Canonical SMILES: C(=O)(NN)NO
2. InChI: InChI=1S/CH5N3O2/c2-3-1(5)4-6/h6H,2H2,(H2,3,4,5)
3. InChIKey: CNRHKPRBIKMGPQ-UHFFFAOYSA-N
About|Contact|Cas|Product Name|Molecular|Country|Encyclopedia
Message|New Cas|MSDS|Service|Advertisement|CAS DataBase|Article Data|Manufacturers | Chemical Catalog
©2008 LookChem.com,License: ICP
NO.:Zhejiang16009103
complaints:service@lookchem.com Desktop View