The L-Phenylalanine,4-azido-, with the CAS registry number 33173-53-4, is also known as 4-Azido-L-phenylalanine. This chemical's molecular formula is C9H10N4O2 and molecular weight is 206.2. What's more, both its IUPAC name and systematic name are the same which is called (2S)-2-Amino-3-(4-azidophenyl)propanoic acid.
Physical properties about L-Phenylalanine,4-azido- are: (1)ACD/LogP: 0.65; (2)# of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 1; (6)ACD/KOC (pH 7.4): 1; (7)#H bond acceptors: 6; (8)#H bond donors: 3; (9)#Freely Rotating Bonds: 5; (10)Polar Surface Area: 75.68 Å2.
You can still convert the following datas into molecular structure:
(1) SMILES: c1cc(ccc1C[C@@H](C(=O)O)N)N=[N+]=[N-]
(2) InChI: InChI=1/C9H10N4O2/c10-8(9(14)15)5-6-1-3-7(4-2-6)12-13-11/h1-4,8H,5,10H2,(H,14,15)/t8-/m0/s1
(3) InChIKey: NEMHIKRLROONTL-QMMMGPOBBA
About|Contact|Cas|Product Name|Molecular|Country|Encyclopedia
Message|New Cas|MSDS|Service|Advertisement|CAS DataBase|Article Data|Manufacturers | Chemical Catalog
©2008 LookChem.com,License: ICP
NO.:Zhejiang16009103
complaints:service@lookchem.com Desktop View