The Magnesol (TN), with the CAS registry number 473596-26-8, is also known as Magnesium sulfate - glucose mixt. This chemical's molecular formula is C6H12MgO10S and molecular weight is 300.52. What's more, its systematic name is magnesium sulfate - D-glucose (1:1:1).
Physical properties of Magnesol (TN) are: (1)#H bond acceptors: 10; (2)#H bond donors: 7; (3)#Freely Rotating Bonds: 10; (4)Polar Surface Area: 151.86 Å2.
You can still convert the following datas into molecular structure:
(1)Canonical SMILES: [Mg+2].[O-]S([O-])(=O)=O.O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO
(2)InChI: InChI=1/C6H12O6.Mg.H2O4S/c7-1-3(9)5(11)6(12)4(10)2-8;;1-5(2,3)4/h1,3-6,8-12H,2H2;;(H2,1,2,3,4)/q;+2;/p-2/t3-,4+,5+,6+;;/m0../s1
(3)InChIKey: XAYNBICVSSHMCS-JIJYNAILBZ
About|Contact|Cas|Product Name|Molecular|Country|Encyclopedia
Message|New Cas|MSDS|Service|Advertisement|CAS DataBase|Article Data|Manufacturers | Chemical Catalog
©2008 LookChem.com,License: ICP
NO.:Zhejiang16009103
complaints:service@lookchem.com Desktop View