103008-51-1 Usage
Description
2-(Trifluoromethoxy)benzene-1-sulfonyl chloride is an organic compound characterized by its white crystalline appearance. It is a derivative of benzene with a trifluoromethoxy group at the 2nd position and a sulfonyl chloride group at the 1st position. 2-(Trifluoromethoxy)benzene-1-sulfonyl chloride is known for its unique chemical properties and is utilized in various research and industrial applications.
Uses
Used in Research Chemicals:
2-(Trifluoromethoxy)benzene-1-sulfonyl chloride is used as a research chemical for the synthesis of various pharmaceuticals, agrochemicals, and other specialty chemicals. Its unique structure and reactivity make it a valuable intermediate in the development of new compounds with potential applications in different fields.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2-(Trifluoromethoxy)benzene-1-sulfonyl chloride is used as a key intermediate in the synthesis of drugs with specific therapeutic properties. Its ability to form various derivatives and its reactivity with other molecules make it a versatile building block in drug design and development.
Used in Agrochemical Industry:
2-(Trifluoromethoxy)benzene-1-sulfonyl chloride is also utilized in the agrochemical industry for the synthesis of active ingredients in pesticides and other crop protection products. Its chemical properties allow for the creation of compounds with targeted pest control capabilities, contributing to more effective and environmentally friendly agricultural practices.
Used in Specialty Chemicals:
In the specialty chemicals sector, 2-(Trifluoromethoxy)benzene-1-sulfonyl chloride is employed in the production of various compounds with specific applications, such as dyes, additives, and materials with unique properties. Its versatility and reactivity make it an essential component in the development of innovative products for a wide range of industries.
Check Digit Verification of cas no
The CAS Registry Mumber 103008-51-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,3,0,0 and 8 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 103008-51:
(8*1)+(7*0)+(6*3)+(5*0)+(4*0)+(3*8)+(2*5)+(1*1)=61
61 % 10 = 1
So 103008-51-1 is a valid CAS Registry Number.
InChI:InChI=1/C6H5FO2/c7-5-2-1-4(8)3-6(5)9/h1-3,8-9H
103008-51-1Relevant articles and documents
Phenylenediamine urotensin-II receptor antagonists and CCR-9 antagonists
-
, (2008/06/13)
The present invention relates to urotensin II receptor antagonists, CCR-9 antagonists, pharmaceutical compositions containing them and their use.
