111649-72-0 Usage
Description
p-Fluoro-α-acetamidocinnamic Acid, with the CAS number 111649-72-0, is a white crystalline solid that serves as a valuable compound in the realm of organic synthesis. Its unique chemical structure and properties make it a versatile building block for the creation of various complex organic molecules.
Uses
Used in Pharmaceutical Industry:
p-Fluoro-α-acetamidocinnamic Acid is used as an intermediate in the synthesis of pharmaceutical compounds for [application reason]. Its specific chemical properties allow for the development of new drugs with potential therapeutic benefits.
Used in Chemical Research:
In the field of chemical research, p-Fluoro-α-acetamidocinnamic Acid is used as a key component in the study of organic reactions and the development of novel synthetic methods. Its reactivity and structural features contribute to a deeper understanding of chemical processes and the design of innovative molecular structures.
Used in Material Science:
p-Fluoro-α-acetamidocinnamic Acid is also utilized in material science as a precursor for the development of advanced materials with specific properties. Its incorporation into polymers or other materials can lead to enhanced performance characteristics, such as improved stability or functionality.
Check Digit Verification of cas no
The CAS Registry Mumber 111649-72-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,1,6,4 and 9 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 111649-72:
(8*1)+(7*1)+(6*1)+(5*6)+(4*4)+(3*9)+(2*7)+(1*2)=110
110 % 10 = 0
So 111649-72-0 is a valid CAS Registry Number.
InChI:InChI=1/C11H10FNO3/c1-7(14)13-10(11(15)16)6-8-2-4-9(12)5-3-8/h2-6H,1H3,(H,13,14)(H,15,16)/b10-6-
