1199-69-5 Usage
Description
4-(2-AMINO-ETHYL)-BENZOIC ACID, also known as AEB, is an organic compound with the molecular formula C9H11NO2. It is a derivative of benzoic acid, featuring an aminoethyl group attached to the 4-position of the benzene ring. 4-(2-AMINO-ETHYL)-BENZOIC ACID is known for its potential applications in various fields, particularly in the pharmaceutical and chemical industries, due to its unique chemical structure and properties.
Uses
Used in Pharmaceutical Industry:
4-(2-AMINO-ETHYL)-BENZOIC ACID is used as a reagent for the preparation of amino acid derivatives with anticancer activity. Its unique structure allows it to be a key component in the synthesis of various compounds that can target and inhibit cancer cell growth, making it a valuable asset in the development of novel anticancer drugs.
In the development of anticancer agents, AEB can be used to create amino acid derivatives that can modulate oncological signaling pathways, similar to the way gallotannin does. These derivatives can potentially exert inhibitory effects on tumor growth and progression, offering new therapeutic options for cancer treatment.
Additionally, AEB can be utilized in the design and synthesis of drug delivery systems, such as organic and metallic nanoparticles, to improve the delivery, bioavailability, and therapeutic outcomes of anticancer drugs. By incorporating AEB into these systems, researchers can enhance the efficacy of existing chemotherapeutic drugs and develop more targeted treatments for various types of cancer.
Check Digit Verification of cas no
The CAS Registry Mumber 1199-69-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,1,9 and 9 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 1199-69:
(6*1)+(5*1)+(4*9)+(3*9)+(2*6)+(1*9)=95
95 % 10 = 5
So 1199-69-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H11NO2/c10-6-5-7-1-3-8(4-2-7)9(11)12/h1-4H,5-6,10H2,(H,11,12)
1199-69-5Relevant articles and documents
Muraminomicins, novel ester derivatives: in vitro and in vivo antistaphylococcal activity
Kagoshima, Yoshiko,Tokumitsu, Akane,Masuda, Takeshi,Namba, Eiko,Inoue, Harumi,Sugihara, Chika,Yokoyama, Mizuka,Yamamoto, Yuko,Suzuki, Keiko,Iida, Kouki,Tamura, Akihiro,Fujita, Yoko,Takatsu, Toshio,Konosu, Toshiyuki,Koga, Tetsufumi
, p. 956 - 969 (2019)
Novel muraminomicin derivatives with antimicrobial activity against methicillin-resistant Staphylococcus aureus (MRSA) were synthesized by esterification of the hydroxy group on the diazepanone ring of muraminomicin Z1. Compound 1b (DS14450354)
