143832-52-4 Usage
Description
(5-AMINO-4 H-[1,2,4]TRIAZOL-3-YL)-ACETIC ACID is an organic compound characterized by its unique chemical structure, which features a triazole ring and an acetic acid functional group. (5-AMINO-4 H-[1,2,4]TRIAZOL-3-YL)-ACETIC ACID is known for its potential applications in various fields due to its chemical properties and reactivity.
Uses
Used in Pharmaceutical Industry:
(5-AMINO-4 H-[1,2,4]TRIAZOL-3-YL)-ACETIC ACID is used as a chemical intermediate for the synthesis of various acylated 1,2,4-triazole-3-acetates. These synthesized compounds have potential anti-inflammatory activity, making them valuable in the development of new drugs and therapies for treating inflammation-related conditions.
Used in Chemical Synthesis:
(5-AMINO-4 H-[1,2,4]TRIAZOL-3-YL)-ACETIC ACID serves as a key building block in the synthesis of a range of chemical compounds with diverse applications. Its unique structure allows for further functionalization and modification, enabling the creation of new molecules with specific properties and potential uses in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 143832-52-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,3,8,3 and 2 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 143832-52:
(8*1)+(7*4)+(6*3)+(5*8)+(4*3)+(3*2)+(2*5)+(1*2)=124
124 % 10 = 4
So 143832-52-4 is a valid CAS Registry Number.
InChI:InChI=1/C4H6N4O2/c5-4-6-2(7-8-4)1-3(9)10/h1H2,(H,9,10)(H3,5,6,7,8)
