291536-42-0 Usage
Description
5-(4-Fluorobenzyl)-2,4-thiazolidinedione, with the CAS number 291536-42-0, is an organic compound that holds significant value in the field of organic synthesis. It is characterized by its unique molecular structure, which incorporates a fluorobenzyl group attached to a thiazolidinedione core. This structure endows the compound with specific chemical properties that make it a versatile building block for the creation of various complex organic molecules.
Uses
Used in Organic Synthesis:
5-(4-Fluorobenzyl)-2,4-thiazolidinedione is used as a synthetic intermediate for the development of a wide range of organic compounds. Its unique structure allows it to serve as a key building block in the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals. The presence of the fluorobenzyl group and the thiazolidinedione core provides opportunities for further functionalization and modification, enabling the creation of diverse molecular structures with tailored properties.
In the Pharmaceutical Industry:
5-(4-Fluorobenzyl)-2,4-thiazolidinedione is used as a starting material for the synthesis of novel drug candidates. Its unique structure can be exploited to design and develop new molecules with potential therapeutic applications. The fluorine atom in the molecule can influence the pharmacokinetic and pharmacodynamic properties of the resulting drug candidates, potentially enhancing their efficacy and safety profiles.
In the Agrochemical Industry:
5-(4-Fluorobenzyl)-2,4-thiazolidinedione is used as a precursor in the development of new agrochemicals, such as pesticides and herbicides. Its structural features can be utilized to create molecules with improved activity against target pests and weeds, while minimizing their impact on non-target organisms and the environment.
In the Specialty Chemicals Industry:
5-(4-Fluorobenzyl)-2,4-thiazolidinedione is employed as a versatile intermediate for the synthesis of various specialty chemicals, including dyes, pigments, and additives. Its unique structure can be modified to produce molecules with specific properties, such as enhanced color intensity, improved stability, or increased compatibility with other materials.
Check Digit Verification of cas no
The CAS Registry Mumber 291536-42-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,9,1,5,3 and 6 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 291536-42:
(8*2)+(7*9)+(6*1)+(5*5)+(4*3)+(3*6)+(2*4)+(1*2)=150
150 % 10 = 0
So 291536-42-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H8FNO2S/c11-7-3-1-6(2-4-7)5-8-9(13)12-10(14)15-8/h1-4,8H,5H2,(H,12,13,14)
291536-42-0Relevant articles and documents
Structural characterization of impurities in pioglitazone
Kumar,Reddy,Eswaraiah,Mukkanti,Reddy,Suryanarayana
, p. 836 - 839 (2007/10/03)
In the pioglitazone bulk drug three prominent impurities I-III were detected up to concentrations of 0.1% (ranging from 0.05-0.1%) by reversed phase HPLC. These impurities were isolated from enriched mother liquor samples and characterized as 5-(4-hydroxybenzyl)-1,3-thiazolidine-2,4-dione (I) 5-(4-fluorobenzyl)-1,3-thiazolidine-2,4-dione (II), 2-[2-(4-bromophenoxy) ethyl-5-ethyl pyridine (III) based on their 1H, and 13C NMR, DEPT, Mass and IR spectral data. Structure elucidation and synthesis of these impurities is discussed.
