363-36-0 Usage
Description
Kynuramine, also known as 2-(3-aminopropanoyl)aniline, is an aromatic ketone derived from the substitution of aniline at position 2 by a 3-aminopropanoyl group. It is a compound with potential applications in various industries due to its unique chemical structure and properties.
Uses
Used in Pharmaceutical Industry:
Kynuramine is used as an intermediate compound for the synthesis of various pharmaceuticals. Its unique structure allows it to be a key component in the development of new drugs, particularly those targeting the central nervous system.
Used in Chemical Research:
Kynuramine serves as a valuable research tool in the field of chemistry, particularly in the study of aromatic ketones and their derivatives. Its properties can be further explored to understand its potential applications in various chemical reactions and processes.
Used in Material Science:
Due to its aromatic ketone structure, Kynuramine may have potential applications in the development of new materials with specific properties, such as those used in the electronics or polymer industries. Further research is needed to fully understand its potential in this area.
Check Digit Verification of cas no
The CAS Registry Mumber 363-36-0 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 3,6 and 3 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 363-36:
(5*3)+(4*6)+(3*3)+(2*3)+(1*6)=60
60 % 10 = 0
So 363-36-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H12N2O/c10-6-5-9(12)7-3-1-2-4-8(7)11/h1-4H,5-6,10-11H2
