| CAS Number | Product Names |
|---|
| 813-19-4 | Hexabutyldistannane |
| 1262-21-1 | Distannoxane,1,1,1,3,3,3-hexaphenyl- |
| 17946-70-2 | Distannoxane,hexakis(4-chlorophenyl)- (9CI) |
| 4151-69-3 | Disulfide,1,1-dimethylethyl ethyl (9CI) |
| 35964-48-8 | Disulfide,bis(4-chloro-3-nitrophenyl) |
| 5873-93-8 | Disulfide,bis(phenylthioxomethyl) |
| 10031-68-2 | Diammonium disulfate |
| 32736-64-4 | Disulfurous acid,ammonium salt (1:2) |
| 13701-74-1 | Diterbium tritungsten dodecaoxide |
| 13090-49-8 | Dithieno(3,4-b:3,4-d)thiophene |
| 236-63-5 | Dithieno[2,3-b:3',2'-d]thiophene |
| 7631-94-9 | Dithionic acid, sodiumsalt (1:2) |
| 15512-36-4 | Dithionousacid, calcium salt (1:1) |
| 6994-93-0 | DL-10-Camphorsulfonyl Chloride |
| 78966-69-5 | DL-2-Amino-7-phosphonoheptanoic acid |
| 34069-57-3 | DL-4-Amino-2-fluorobutyric acid |
| 71463-44-0 | DL-Acetylmethionine magnesium salt |
| 63905-32-8 | DL-Alanine, N- (2-cyanoethyl)- |
| 111320-19-5 | D-Leucine, N-L-a-glutamyl- (9CI) |
| 71184-74-2 | D-Leucine,N-(N-glycylglycyl)- (9CI) |
| 119290-61-8 | DL-Phenylalanine-obzl p-tosylate |
| 154-86-9 | DL-Phenylephrine hydrochloride |
| 106910-76-3 | DL-Serine, N-(phenylmethyl)- |
| 15232-63-0 | d-Lysergic acid diethylamide bitartrate |
| 575-64-4 | D-Mannofuranuronicacid, g-lactone |
| 27251-84-9 | D-Mannopyranose,1-(dihydrogen phosphate) |
| 31077-88-0 | D-Mannopyranose,2-deoxy-2-fluoro- |
| 202578-52-7 | DMP 696 |
| 202579-74-6 | DMP 904 |
| 71629-86-2 | D-Norleucine,6-diazo-5-oxo- (9CI) |
| 85263-74-7 | Docosanoic acid, phenylmethylester |
| 18641-57-1 | Docosanoic acid,1,2,3-propanetriyl ester |
| 80252-39-7 | Docosanoic acid,triacontyl ester |
| 36143-29-0 | Dodec-2-ynoic acid |
| 63451-21-8 | Dodecanamide,N-(2-aminoethyl)-N-(2-hydroxyethyl)- |
| 42234-04-8 | Dodecanedioic acid,1,12-dihexadecyl ester |
| 27742-10-5 | Dodecanedioic acid,1,12-ditridecyl ester |
| 2123-88-8 | Dodecaneperoxoic acid,1,1-dimethylethyl ester |
| 19998-93-7 | Dodecanoic acid, 4-methyl- |
| 4696-57-5 | Dodecanoic acid, bariumsalt (2:1) |
| 2452-01-9 | Dodecanoic acid, zincsalt (2:1) |
| 2874-73-9 | Dodecanoic acid,2,2-dimethyl- |
| 72864-23-4 | Dodecanoic acid,3-hydroxy-, methyl ester |
| 22412-97-1 | Dodecanoic acid,tetradecyl ester |
| 28692-94-6 | Dodecanoicacid, compd. with piperidine (1:1) |
| 20834-06-4 | Dodecanoicacid, hexadecyl ester |
| 1322-36-7 | Dodecyl thiol |
| 67762-66-7 | Dodecyl vinyl ether, compound with tolyltriazole |
| 51186-33-5 | Dodecyl-dimethyl-sulfanium; sulfonatooxymethane |
| 16937-91-0 | D-Ornithine,N5-[(phenylmethoxy)carbonyl]- |
| 68523-18-2 | Dowco 417 |
| 7695-56-9 | D-Phenylalanine, b-hydroxy-, (bS)-rel- |
| 137503-97-0 | D-Phenylalanine,N-(chloroacetyl)- (9CI) |
| 21156-62-7 | D-Phenylalanine,N-acetyl-, methyl ester |
| 104504-42-9 | D-Phenylalanine,N-acetyl-4-benzoyl- |
| 146664-09-7 | D-Phenylalanine,N-acetyl-4-cyano- |
| 201351-59-9 | D-Phenylalanine,N-acetyl-4-iodo- |
| 172478-10-3 | D-Proline, 1-(phenylmethyl)-, ethylester |
| 126522-74-5 | D-Proline,1-[(2,4,6-trimethylphenyl)sulfonyl]- |
| 637020-88-3 | D-Proline,2-[(2-bromophenyl)methyl]- |
| 637020-76-9 | D-Proline,2-[(2-chlorophenyl)methyl]- |
| 637020-70-3 | D-Proline,2-[(4-fluorophenyl)methyl]- |
| 637020-64-5 | D-Proline,2-[(4-methylphenyl)methyl]- |
| 103290-41-1 | D-Proline,4-phenyl-, trans- (9CI) |
| 35320-17-3 | D-Ribitol,5-(dihydrogen phosphate) |
| 30361-19-4 | D-Ribofuranose,2-C-methyl-, 1,2,3,5-tetrabenzoate |
| 19794-48-0 | D-Serine, hydrogensulfate (ester) (9CI) |
| 201274-09-1 | D-Threonine-obzl oxalate (1:1) |
| 61535-49-7 | D-Tryptophan, ethylester, hydrochloride (1:1) |
| 160955-40-8 | D-Tryptophan,N-(carboxymethyl)- |
| 79631-04-2 | D-Tryptophan,N-(methoxycarbonyl)-, methyl ester |
| 3916-18-5 | D-Tyrosine, b,3-dihydroxy-, (bS)-rel- |
| 33043-37-7 | D-Tyrosine,N-acetyl-3-methoxy-O-methyl- |
| 210830-32-3 | N-Methyl-D-valine hydrochloride |
| 53978-73-7 | D-Valine, N-methyl-N-[(phenylmethoxy)carbonyl]- |
| 79032-48-7 | D-Valine,N-acetyl-3-(nitrosothio)- |
| 15537-71-0 | D-Valine, N-acetyl-3-mercapto- |
| 539-68-4 | Dihydroxyaluminum sodium carbonate |
| 2685-64-5 | Diphenylperoxyanhydride |
| 94094-82-3 | Diethyl hydrogen phosphate, compound with guanidine (2:1) |
| 92455-53-3 | D-Tyrosine,N-[(phenylmethoxy)carbonyl]-O-(phenylmethyl)- |
| 85466-66-6 | BOC-D-MEPHE-OH |
| 84750-88-9 | Dimethyl perfluoro-1,10-decanedicarboxylate |
| 83898-56-0 | Decyl (Z,Z,Z)-6-butyl-6-[[4-(decyloxy)-1,4-dioxobut-2-enyl]oxy]-4,8,11-trioxo-5,7,12-trioxa-6-stannadocosa-2,9-dienoate |
| 83-05-6 | DDA |
| 81810-13-1 | Dipyrido[1,2-a:3',2'-d]imidazole,4-chloro-2,6-dimethyl- (9CI) |
| 79483-68-4 | Dan-shen |
| 77004-75-2 | N-Boc-D-aspartic acid 1-(tert-butyl) ester |
| 76258-20-3 | Dimethyl 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate |
| 67257-29-8 | Diethyl-3-chloro-2-oxopropyl phosphonate |
| 6406-30-0 | Disodium 8-(phenylamino)-5-((4-(phenylazo)-7-sulphonato-1-naphthyl)azo)naphthalenesulphonate |
| 6381-63-1 | DL-Pantothenic acid calcium salt |
| 6342-72-9 | Dimethyl 2-hydroxyterephthalate |
| 61142-90-3 | Diazenesulfonic acid,2-hydroxy-, 1-oxide, ammonium salt (1:2) |
| 59752-57-7 | Dodecanoic acid,1,1'-[(1R)-1-[[[(2-aminoethoxy)hydroxyphosphinyl]oxy]methyl]-1,2-ethanediyl]ester |
| 54328-09-5 | Protopseudohypericin |
| 53170-19-7 | Dimethyl-d<sub>6</sub>-amine hydrochloride |
| 52623-75-3 | Disperse red 118 |
| 52589-12-5 | Diginatin |
| 518-61-6 | Dacemazine |