The 1H-Indole-2,3-dione,6-chloro-7-fluoro-, with the CAS registry number 942493-23-4, is also known as 6-Chloro-7-fluoroisatin. This chemical's molecular formula is C8H3ClFNO2 and molecular weight is 199.5663. Its systematic name is called 6-chloro-7-fluoro-indoline-2,3-dione.
Physical properties of 1H-Indole-2,3-dione,6-chloro-7-fluoro-: (1)ACD/LogP: 1.66; (2)ACD/LogD (pH 5.5): 1.66; (3)ACD/LogD (pH 7.4): 1.38; (4)#H bond acceptors: 3; (5)#H bond donors: 1; (6)Index of Refraction: 1.599; (7)Molar Refractivity: 42.31 cm3; (8)Molar Volume: 123.7 cm3; (9)Surface Tension: 54.1 dyne/cm; (10)Density: 1.613 g/cm3.
You can still convert the following datas into molecular structure:
(1)SMILES: c1cc(c(c2c1C(=O)C(=O)N2)F)Cl
(2)InChI: InChI=1/C8H3ClFNO2/c9-4-2-1-3-6(5(4)10)11-8(13)7(3)12/h1-2H,(H,11,12,13)
(3)InChIKey: KPIXRLPJNJURAJ-UHFFFAOYAJ
About|Contact|Cas|Product Name|Molecular|Country|Encyclopedia
Message|New Cas|MSDS|Service|Advertisement|CAS DataBase|Article Data|Manufacturers | Chemical Catalog
©2008 LookChem.com,License: ICP
NO.:Zhejiang16009103
complaints:service@lookchem.com Desktop View